Top 13 # Giải Thuật Des / 2023 Xem Nhiều Nhất, Mới Nhất 12/2022 # Top Trend | Caffebenevietnam.com

Thuật Toán Mã Hóa Và Giải Mã Des / 2023

Bài viết này giới thiệu về thuật toán mã hóa và giải mã dữ liệu DES (Data Encryption Standard). Đây là thuật toán mã hóa dữ liệu được công bố 25/10/1999 trong tài liệu về chuẩn xử lý thông tin liên bang Hoa Kỳ FIPS 46-3.1. Một số thuật ngữ sử dụng

Encipher – Bộ mã hóa

Decipher – Bộ giải mã

Plaintext – Bản rõ là dữ liệu gốc chưa được mã hóa

Ciphertext – Bản mã là dữ liệu đã dược mã hóa

Key – khóa mã là một giá trị được sử dụng để mã hóa và giải mã

Round key – khóa vòng là những giá trị trung gian được tạo ra từ khóa mã trong suốt quá trình mã hóa và giải mã

2. Thuật toán mã hóa dữ liệu DES – Encipher

2.1 Lưu đồ thuật toán mã hóa

Thuật toán DES được sử dụng để mã hóa và giải mã các block (khối) dữ liệu 64 bit dựa trên một key (khóa mã) 64 bit. Chú ý, các block được đánh số thứ tự bit từ trái sang phải và bắt đầu từ 1, bit đầu tiên bên trái là bit số 1 và bit cuối cùng bên phải là bit số 64. Quá trình giải mã và mã hóa sử dụng cùng một key nhưng thứ tự phân phối các giá trị các bit key của quá trình giải mã ngược với quá trình mã hóa.

Một block dữ liệu sẽ được hoán vị khởi tạo (Initial Permutation) IP trước khi thực hiện tính toán mã hóa với key. Cuối cùng, kết quả tính toán với key sẽ được hoán vị lần nữa để tạo ra , đây là hoán vị đảo của hoán vị khởi tạo gọi là (Inverse Initial Permutation) IP-1. Việc tính toán dựa trên key được định nghĩa đơn giản trong một hàm f, gọi là hàm mã hóa, và một hàm KS, gọi là hàm phân phối key (key schedule). Hàm KS là hàm tạo ra các khóa vòng (round key) cho các lần lặp mã hóa. Có tất cả 16 khóa vòng từ K1 đến K16.2.2 Hoán vị khởi tạo – IP

Hoán vị là thay đổi ví trí các bit trong một chuỗi giá trị nhưng không làm thay đổi giá trị của các bit này. Đây là bước đầu tiên trong quy trình mã hóa dữ liệu. 64 bit dữ liệu đầu vào, gọi là plaintext, sẽ được hoán vị theo bảng mô tả sau đây. Chuỗi bit đầu vào được đánh số từ 1 đến 64 (tính từ trái qua phải). Sau đó, các bit này được thay đổi vị trí như sơ đồ IP, bit số 58 được đặt vào vị trí đầu tiên, bit số 50 được đặt vào vị trí thứ 2. Cứ như vậy, bit thứ 7 được đặt vào vị trí cuối cùng.

Sau hoán vị, chuỗi bit mới được phân ra làm hai đoạn, mỗi đoạn 32 bit để bắt đầu vào quy trình tính toán mã hóa với key. Đoạn bên trái ký hiệu là L, đoạn bên phải ký hiệu là R. Đoạn L gồm các bit từ bit số 1 đến bit số 32, đoạn R gồm các bit từ bit số 33 đến bit số 64. Đoạn L của lần tính toán sau sẽ chính là đoạn R của lần tính toán trước. Đoạn R của lần tính toán sau sẽ được tính từ đoạn R trước đó qua hàm mã hóa f(R, K) rồi XOR với đoạn L của lần tính trước đó.

2.3 Hàm mã hóa f(R,K) Đầu tiên, 32 bit của đoạn R được đánh số từ 1 đến 32 theo thứ tự từ trái qua phải. Giá trị này sẽ được chuyển đổi thông qua bảng tra E để tạo thành một giá trị 48 bit. Bit đầu tiên trong chuỗi giá trị 48 bit là bit số 32 của R, bit thứ 2 là bit số 1 của R, bit thứ 3 là bit số 2 của R và bit cuối cùng là bit số 1 của R. Sau khi tra bảng E, giá trị 48 bit được XOR với 48 bit của khóa vòng (cách tạo ra khóa vòng 48 bit sẽ được trình bày sau). Kết quả phép XOR được chia làm 8 block được đánh số từ 1 đến 8 theo thứ tự từ trái qua phải, mỗi block 6 bit. Mỗi block sẽ được biến đổi thông qua các hàm lựa chọn riêng biệt. Tương ứng với 8 block sẽ có 8 hàm chuyển đổi (selection function) riêng biệt là S1, S2, S3, S4, S5, S6, S7 và S8. Việc chuyển đổi giá trị của các hàm S1, S2, …, S8 được thực hiện bằng cách tách block 6 bit thành hai phần. Phần thứ nhất là tổ hợp của bit đầu tiên và bit cuối cùng của block để tạo thành 2 bit chọn hàng của bảng S, bảng S có 4 hàng được đánh số từ 0 đến 3 theo thứ tự từ trên xuống. Phần thứ 2 là 4 bit còn lại dùng để chọn cột của bảng S, bảng S có 16 cột được đánh số từ 0 đến 15 theo thứ tự từ trái qua phải. Như vậy, với mỗi block 8 bit ta chọn được 1 giá trị trong bảng S. Giá trị này nằm trong khoảng từ 0 đến 15 sẽ được quy đổi thành chuỗi nhị phân 4 bit tương ứng. Các chuỗi nhị phân có được sau khi chuyển đổi từ S1 đến S8 sẽ được ghép lại theo thứ tự từ trái qua phải để tạo thành một giá trị 32 bit.

Qua bước chuyển đổi với các hàm lựa chọn S, kết quả thu được là một giá trị 32 bit. Giá trị này được đưa qua một hàm hoán vị P để tạo ra giá trị hàm f. Giá trị 32 bit thu được từ các chuyển đổi với hàm lựa chọn S sẽ được đánh số từ 1 đến 32 theo thứ tự từ trái qua phải.

Theo bảng hoán vị P, bit đầu tiên sau hoán vị sẽ là bit số 16, bit thứ 2 sẽ là bit số 7 và bit cuối cùng sẽ là bit số 25. Hàm tính toán mã hóa f(R, K) được định nghĩa như sau:

P(): là phép hoán vị P

Sn: là phép chuyển đổi block n (n chạy từ 1 đến 8) với hàm lựa chọn S

Bn: là block 6 bit thứ n (n chạy từ 1 đến 8). Block này lấy từ phép toán XOR giữa khóa vòng K và giá trị hàm E(R)

E(R): là hàm chuyển đổi giá trị R 32 bit thành giá trị 48 bit

Một key có 64 bit nhưng chỉ có 56 bit được sử dụng để thực hiện tính toán giá trị khóa vòng. Key được chia làm 8 byte. Các bit ở vị trí 8, 16, 32, 40, 48, 56 và 64 là các bit parity được sử dụng để kiểm tra độ chính xác của key theo từng byte vì khi key được phân phối trên đường truyền đến bộ mã hóa giải mã thì có thể xảy ra lỗi. Parity được sử dụng là parity lẻ (odd parity). Key gốc sẽ được thực hiện hoán vị lựa chọn PC-1. Key được đánh số từ 1 đến 64 theo thứ tự từ trái qua phải. Bảng hoán vị lựa chọn PC-1 có hai phần. Phần đầu dùng để xác định giá trị C0 và phần sau dùng để xác định giá trị D0. Theo bảng trên thì C0 là chuỗi bit có thứ tự là 57, 49, 41, …, 36 lấy từ key gốc, D0 là chuỗi bit có thứ tự là 63, 55, 47, …, 4 lấy từ key gốc.

Sau khi xác định được giá trị ban đầu để tính key là C0 và D0 thì các khóa vòng Kn (với n từ 1 đến 16) sẽ được tính theo nguyên tắc giá trị của khóa vòng thứ n sẽ được tính từ giá trị khóa vòng thứ n-1.

Trong đó Cn và Dn được tạo từ Cn-1 và Dn-1 bằng cách dịch trái các giá trị này với số bit được quy định trong bảng sau đây: Ví dụ, theo bảng trên, C3 và D3 có được từ C2 và D2 bằng cách dịch trái 2 bit. Hay C16 và D16 có được từ C15 và D15 bằng cách dịch trái 1 bit. Dịch trái ở đây được hiểu là quay trái như minh họa sau đây:

Sau khi tính được Cn và Dn thì chuỗi CnDn sẽ được đánh số từ 1 đến 56 theo thứ tự từ trái sang phải và được hoán vị lựa chọn lần 2 theo bảng hoán vị PC-2. Như vậy bit đầu tiên của khóa vòng Kn là bit số 14 của chuỗi CnDn, bit thứ 2 là bit số 17 của chuỗi CnDn và bit cuối cùng là bit số 32 của chuỗi CnDn.

2.5 Hoán vị khởi tạo đảo IP-1

Đây là bước cuối cùng để tạo ra giá trị mã hóa. Giá trị của lần lặp mã hóa cuối cùng sẽ được hoán vị khởi tạo đảo IP-1 và tạo ra giá trị mã hóa plaintext.2.6 Ví dụ về mã hóa DES

Giả sử ta có dữ liệu cần mã hóa và key là:

M = 00123456789abcde (Hex) = 0000 0000 0001 0010 0011 0100 0101 0110 0111 1000 1001 1010 1011 1100 1101 1111

K = 0133457799bbcdff (Hex) = 0000 0001 0011 0011 0100 0101 0111 0111 1001 10001 1011 1011 1100 1100 1111 1111

Từ hai đầu vào này, giá trị của từng bước tính toán mã hóa DES sẽ được minh họa chi tiết sau đây.

2.6.1 Hoán vị khởi tạo – IP

Thông điệp M được đánh số vị trí bit từ trái qua phải như sau:

Sắp xếp lại thứ tự các bit của M theo bảng hoán vị IP, kết quả có được sau bước này là:

IP(M) = 98fecc00e054f0aa (Hex) = 1001 1000 1111 1110 1100 1100 0000 0000 1110 0000 0101 0100 1111 0000 1010 1010

2.6.2 Tính toán giá trị các khóa vòng – KS

Để tính toán hàm mã hóa f, chúng ta cần có giá trị khóa cho từng lần lặp mã hóa. Key ban đầu được đánh số thứ tự bit từ trái qua phải như sau:

Sau khi sắp xếp các bit theo bảng hoán vị PC-1 ở Hình 1‑8, kết quả thu được là hai giá trị đầu như sau:

C0 = f0ccaab (Hex) = 1111 0000 1100 1100 1010 1010 1011

D0 = aaccf0a (Hex) = 1010 1010 1100 1100 1111 0000 1010

Để tính khóa vòng đầu tiên K1 thì C0 và D0 sẽ được dịch (quay) trái 1 bit. Giá trị thu được sau khi dịch trái là:

C1 = e199557 (Hex) = 1110 0001 1001 1001 0101 0101 0111

D1 = 5599e15 (Hex) = 0101 0101 1001 1001 1110 0001 0101

Hai chuỗi C1 và D1 được ghép lài thành một chuỗi 56 bit là e1995575599e15. Chuỗi này được hoán vị bằng bảng PC-2 ở Hình 1‑11 để được giá trị khóa vòng 48 bit thứ nhất K1.

Để tính khóa vòng K2 thì lấy C1 và D1 dịch trái với số lượng bit theo bảng ở Hình 1‑9, rồi lấy kết quả hoán vị theo bảng PC-2. Quá trình cứ tiếp tục cho đến khóa vòng cuối cùng là K16. Kết quả các khóa vòng 48 bit thu được là:

K2 = 69aed925ae66 (Hex)

K3 = 55fc8ab4acd2

K4 = 72add2ad8657

K5 = 7cec071fe6c2

K6 = 63a51e3cc545

K7 = 6c84b78ae4c6

K8 = f7883aece781

K9 = c0dbeb27b839

K10 = b1f347631d76

K11 = 215fc30d89be

K12 = 7171f5455cd5

K13 = 95c5d14b80fd

K14 = 5743b783đ8d

K15 = bf91850a17b5 K16 = cb3d0bbc7072

2.6.3 Tính hàm mã hóa f(R,K)

Sau bước hoán vị khởi tạo IP, giá trị IP(M) sẽ được tách làm hai phần là:

R0 = e054f0aa (Hex) = 1110 0000 0101 0100 1111 0000 1010 1010

L0 = 98fecc00 (Hex) = 1001 1000 1111 1110 1100 1100 0000 0000

Giá trị 32 bit của R0 được tra qua bảng E để tạo ra một giá trị 48 bit.

Giá trị này được XOR với khóa vòng thứ nhất K1 và được kết quả

XOR(E(R0), K1) = 6b0046a15cf0 (Hex)

Giá trị trên được chia thành 8 nhóm theo thứ tự từ trái qua phải, mỗi nhóm 6 bit để đưa đến các bảng S. Các giá trị đầu ra sau bước tra các bảng S sẽ được ghép lại theo thứ tự từ S1 đến S8 để được 1 giá trị 32 bit.

S1()S2()S3()S4()S5()S6()S7()S8() = 10010101110100111010110101010000 = 95d3ad50 (Hex)

Giá trị này được hoán vị bằng bảng P để cho ra giá trị của hàm f.

f(R0,K1) = 97d1619a (Hex) = 1001 0111 1101 0001 0110 0001 1001 1010

Tương tự, ta có giá trị hàm f tại các vòng lặp mã hóa còn lại như sau:

f(R1,K2) = 88488d0b (Hex)

f(R2,K3) = da3b2692

f(R3,K4) = f44950b2

f(R4,K5) = d83237fd

f(R5,K6) = afc43b25

f(R6,K7) = 4e5123a2

f(R7,K8) = 6cfdecb8

f(R8,K9) = fb0600b1

f(R9,K10) = d51508e4

f(R10,K11) = fcf67146

f(R11,K12) = 704fa3a5

f(R12,K13) = 7bfe2806

f(R13,K14) = 65fc7a48

f(R14,K15) = 513f1d11 f(R15,K16) = cbf5252d

2.6.4 Giá trị tại mỗi vòng lặp mã hóa

Giá trị của hàm f(R,K) được sử dụng để tính giá trị Rn và Ln tại mỗi vòng lặp mã hóa theo công thức:

Thay vào công thức trên ta có các kết quả như sau:

2.6.5 Hoán vị khởi tạo đảo IP-1

Giá trị R16 và L16 của vòng lặp mã hóa cuối cùng sẽ được ghép lại thành một chuỗi 64 bit để thực hiện hoán vị theo bảng IP-1.

Kết quả của phép hoán vị này chính là giá trị mã hóa (ciphertext) cần tính.

IP-1(R16, L16) = 1abff69d5a93e80b (Hex) = 0001 1010 1011 1111 1111 0110 1001 1101 0101 1010 1001 0011 1110 1000 0000 1011

3. Thuật toán giải mã dữ liệu DES

Các bước của quá trình giải mã dữ liệu được thực hiện tương tự như quá trình mã hóa dữ liệu. Trong quá trình giải mã có một số thay đổi như sau:

Đầu vào lúc này là dữ liệu cần giải mã (ciphertext) và đầu ra là kết quả giải mã được (plaintext).

Khóa vòng sử dụng trong các vòng lặp giải mã có thứ tự ngược với quá trình mã hóa. Nghĩa là, tại vòng lặp giải mã đầu tiên, khóa vòng được sử dụng là K16. Tại vòng lặp giải mã thứ 2, khóa vòng được sử dụng là K15, và tại vòng lặp giải mã cuối cùng thì khóa vòng được sử dụng là K1.

Hệ Mật Mã Khối Và Các Thuật Toán Mã Hóa Khối Kinh Điển: Des / 2023

Trong bài viết trước, mình đã trình bày về cơ chế hoạt động của giao thức trao chuyển khóa đối xứng Needham – Schroeder . Khóa đó là “khóa phiên”. Vậy “khóa” đó là cái j và được tạo ra như thế nào, độ phức tạp của việc phá giải cũng như ứng dụng của nó ở đâu? Vân vân và mây mây. Tất cả những điều đó sẽ được mình trình bày trong bài viết này.

Bài viết này mình sẽ giới thiệu về Hệ mật mã khối. Sau đó sẽ trình bày thuật toán mã hóa kinh điển DES và các mở rộng của nó như 2-DES và 3-DES; kèm theo đó là ưu nhươc điểm cũng như cách thức tấn công để phá mã. Sau cùng mình sẽ nêu ra những ứng dụng của Hệ mã khối cũng như DES.

hacker cũng ko thể giải được nốt“! Do đó, nếu ta sử dụng nó vào việc mã hóa thì chỉ có ta mới biết Backdoor để phá giải được mã thôi! Toán Học thật ảo diệu và thâm sâu phải ko!

Có lẽ ko có một chuyên ngành nào của Công nghệ thông tin mà sử dụng nhiều Toán như Lý thuyết Mật mã học trong An Toàn Thông Tin cả, mà lại toàn Toán khó mới đểu chứ! Đến bây giờ khi ngồi tự học Cryptography, mình mới thấy sức mạnh thật sự của môn Số Học hồi cấp 2. Hồi trước khi Sư Phụ dạy trên lớp, mình cũng đã thấy được sự bá đạo của các định lý Số Học như Fermat (nhỏ), Euler, Wilson, “Phần dư Trung Hoa” rồi; nhưng có lẽ bây giờ mới tự nhiên thấy được sự ảo diệu của các định lý này. Các bài toán (NP) khó được tìm ra, nếu ko giải được thì ta vẫn có thể sử dụng được nó! Nghe có vẻ xàm xí, đã ko giải được thì biết áp dụng như thế nào? Đúng vậy; chính vì cả thế giới ko thể giải được, thế nên “”! Do đó, nếu ta sử dụng nó vào việc mã hóa thì chỉ có ta mới biếtđể phá giải được mã thôi! Toán Học thật ảo diệu và thâm sâu phải ko!

Hệ mật mã khối (Block Cipher).

Các loại mật mã “ko khối” được gọi chung là “hệ mật mã cổ điển”. Ví dụ tiêu biểu và cổ xưa bậc nhất có lẽ là “Mật mã Caesar” (Caesar là tên của Pharaoh Xê-da); thực hiện mã hóa thay thế từng ký tự bằng cách tịnh tiến bảng chữ cái từ chữ a thành chữ n. Bạn có thể sử dụng Regex (Regular Expression) được hỗ trợ trong

tr

 (translate) command của Linux để mã hóa cũng như giải mã theo ý bạn như sau:

tr a-zA-Z n-za-mN-ZA-M

Mã khối thì khác. Thay vì mã hóa từng ký tự, thuật toán sẽ chia văn bản thành từng cụm vài ký tự một; rồi mã hóa 1 phát toàn bộ mọi ký tự trong từng cụm đó. Do đó, có thể thấy rằng “mã khối” phức tạp và khó phá hơn “mã cổ điển”. Tuy nhiên như vậy vẫn là chưa đủ. Để đánh giá tính an toàn của một hệ mã khối, ta cần dựa vào các điều kiện:

Kích thước của khối mã hóa phải đủ lớn để ngăn chặn việc phá giải tấn công bằng phương pháp “thống kê” như ở mã cổ điển. Tuy nhiên nếu kích thước khối càng lớn thì tỷ lệ thuận theo đó sẽ là thời gian mã hóa lại càng lâu.

Không gian khóa phải đủ lớn để việc Bruteforce attack (vét cạn không gian khóa) gần như là bất khả thi. Tuy nhiên kích thước khóa lại phải đủ bé để đảm bảo mã hóa cũng như giải mã nhanh gọn.

Ở đây xuất hiện 1 khái niệm là “trade-off“; có thể hiểu nôm na là “đánh đổi”. Khái niệm này có mặt ở hầu hết mọi khía cạnh trong cuộc sống. Để đạt được hiệu quả ở một khía cạnh này, ta bắt buộc phải đánh đổi bằng sự hiệu quả của một hoặc một vài khía cạnh khác! Còn thuật ngữ này, công nhận là mình chỉ thấy có ở Lab Sư Phụ mình là hay dùng. Sư Phụ dùng nhiều, nên các anh Nghiên cứu sinh cũng dùng nhiều, rồi đến bọn sinh viên như mấy đứa chúng mình cũng nghe quen và hay dùng.

Ở đây xuất hiện 1 khái niệm là “”; có thể hiểu nôm na là “đánh đổi”. Khái niệm này có mặt ở hầu hết mọi khía cạnh trong cuộc sống. Để đạt được hiệu quả ở một khía cạnh này, ta bắt buộc phải đánh đổi bằng sự hiệu quả của một hoặc một vài khía cạnh khác! Còn thuật ngữ này, công nhận là mình chỉ thấy có ở Lab Sư Phụ mình là hay dùng. Sư Phụ dùng nhiều, nên các anh Nghiên cứu sinh cũng dùng nhiều, rồi đến bọn sinh viên như mấy đứa chúng mình cũng nghe quen và hay dùng.

Đừng lo, ngoài câu thơ (xuất phát từ 1 điển cố buồn) trên, chúng ta còn có câu “Thế gian tự hữu song toàn pháp – Bất phụ mộng tưởng, bất phụ khanh” nữa. 😁

Thuật toán DES (Data Encryption Standard).

Chuẩn mật mã DES là hệ mã được giới thiệu bởi Cục An ninh quốc gia Mỹ (NSA); là hệ mã được sử dụng rộng rãi nhất trong nhiều năm liền trước khi chuẩn mật mã nâng cao AES được công bố. Trong thời gian đó, DES cũng tạo ra khá nhiều nghi ngờ tranh cãi xung quanh việc thiết kế của thuật toán đảm bảo tính bảo mật, chiều dài khóa ngắn, cũng như việc NSA có thể còn che giấu Backdoor để đơn giản hóa quá trình phá giải mã.

Tổng quan.

Đầu vào và đầu ra của DES là 1 chuỗi bit độ dài 64, sử dụng một khóa có độ dài 64 bit làm khóa chính. Tuy nhiên thực tế, chỉ có 56 bit của khóa là được sử dụng, 8 bit còn lại chỉ đóng vai trò kiểm tra tính chẵn/lẻ. Do đó “độ dài thực tế” của khóa chỉ là 56 bit.

Sơ đồ thuật toán sinh mã DES với 16 vòng lặp (sách của Sư Phụ)

f như trong hình. Hàm f này có cấu trúc phức tạp sẽ trình bày sau, nhưng nó chứa một phép toán logic XOR các thành phần con của bản rõ (plain text) sau khi được “số hóa” bởi tác tử IC. 2 tác tử IC và IC

1

 sẽ chỉ có tác dụng biến đổi văn bản thành chuỗi nhị phân để máy tính hiểu được.

Có thể thấy rằng trong mỗi lần lặp, chuỗi bit sẽ được cắt đôi, mỗi nửa sẽ có độ dài 32 bit. Nửa đầu của chuỗi mới sẽ là nửa sau của chuỗi cũ (

L

i

= R

i – 1

); nửa sau của chuỗi mới sẽ là kết quả của việc thực hiện logic XOR với kết quả sinh ra từ hàm f:

R

i

= L

i – 1

 𐌈 f(

R

i – 1

, K

i

)

Từ hình trên, ta thấy DES được cấu tạo bởi 16 vòng lặp; mỗi lần lặp sẽ thực hiện 1 phép toán logic với hàm logicnhư trong hình. Hàmnày có cấu trúc phức tạp sẽ trình bày sau, nhưng nó chứa một phép toán logiccác thành phần con của bản rõ (plain text) sau khi được “số hóa” bởi tác tử IC. 2 tác tử IC và ICsẽ chỉ có tác dụng biến đổi văn bản thành chuỗi nhị phân để máy tính hiểu được.Có thể thấy rằng trong mỗi lần lặp, chuỗi bit sẽ được cắt đôi, mỗi nửa sẽ có độ dài 32 bit. Nửa đầu của chuỗi mới sẽ là nửa sau của chuỗi cũ (); nửa sau của chuỗi mới sẽ là kết quả của việc thực hiện logic XOR với kết quả sinh ra từ hàm

K

i

 khác nhau. Các giá trị này sẽ được tạo ra từ khóa chính của DES bằng thuật toán sinh khóa con, và độ dài của chúng là giống nhau và đều bằng 48 bit. Đây là lưu đồ mô tả “thuật toán sinh khóa con” của DES.

Thuật toán lập lịch Khóa con.

Key scheduler của DES (Wikipedia)

Có thể thấy rằng mỗi vòng lặp sẽ thực hiện với một giá trịkhác nhau. Các giá trị này sẽ được tạo ra từ khóa chính của DES bằng thuật toán sinh khóa con, và độ dài của chúng là giống nhau và đều bằng 48 bit. Đây là lưu đồ mô tả “thuật toán sinh khóa con” của DES.

Cấu trúc cụ thể của hàm f.

Hàm Feistel (f) trong DES (Wikipedia)

Hình trên diễn tả cấu trúc và hoạt động cụ thể của hàm f (Feistel). Cụ thể ta thấy rằng, ở mỗi vòng lặp, 32 bit của 

R

i – 1

 sẽ được mở rộng thành 48 bit thông qua biến đổi E (Expainsion – mở rộng với sự lặp lại của 1 số bit), sau đó đem XOR với 48 bit của khóa con 

K

i

. Kết quả sau XOR có độ dài 48 bit sẽ bị phân thành 8 nhóm, mỗi nhóm dài 6 bit. Mỗi nhóm này sẽ được đưa vào một biến đổi S

i

 mà được gọi là S-box, tổng cộng có 8 S-box. Mỗi S-box này nhận đầu vào 6 bit sẽ cho đầu ra 4 bit. Sau cùng, kết quả hợp thành một chuỗi 32 bit và nó chính là giá trị R

i

.

Cấu trúc của S-box.

Trong mật mã học, S-box (Substitution-box) là một thành phần căn bản của Thuật toán mã hóa đối xứng SKC, có chức năng thay thế. Trong Hệ mã khối, bao gồm cả DES, S-box có chức năng che giấu mỗi quan hệ giữa bản mã (cipher text) và bản rõ (plain text), nhằm tăng tính hỗn độn (confusion) của thuật toán.

Về mặt tổng quát, S-box nhận đầu vào là 1 chuỗi m bit, sau đó sẽ biến đổi và tạo ra đầu ra n bit (m và n không nhất thiết phải bằng nhau). Một m×n S-box có thể được thực thi như 1 bảng tra cứu với 

2

m từ, mỗi từ có độ dài n bit.

6×4 

S-box (Wikipedia)

Tuy rằng nguyên lý hoạt động khá là đơn giản, nhưng các nguyên tắc thiết kế S-box đã được Chính phủ Mỹ đưa vào lớp các thông tin mật. Mặc dù vậy, NSA vẫn tiết lộ 3 thuộc tính của S-box để khẳng định tính hỗn độn (confusion) và khuếch tán (deffusion):

Các bit ra (OUTPUT bit) phụ thuộc phi tuyến (ko tuyến tính) vào các bit vào (INPUT bit).

Sửa đổi 1 bit INPUT sẽ làm thay đổi ít nhất 2 bit OUTPUT.

Khi INPUT giữ cố định 1 bit và thay đổi 5 bit thì S-box cho ra kết quả là 1 phân phối đều liên tục (Uniform Distribution). Điều này khiến cho việc sử dụng phương pháp “thống kê” trở lên vô ích.

Cấu tạo của S-box đã gây ra tranh cãi rất mạnh mẽ suốt từ 70s – 90s của thế kỷ 20 về khả năng NSA còn che giấu 1 Backdoor giúp cho việc phá giải mã dễ dàng hơn bình thường (giảm không gian khóa xuống dưới 

2

56 để có thể Bruteforce (vét cạn) nhanh hơn. Đặc biệt, sau khi có sự khám phá về hình thức sử dụng “tấn công vi phân” (Differential cryptanalysis) đã củng cố niềm tin rằng nghi ngờ này là có khả năng. Cụ thể Biham và Shamir đã chứng minh rằng chỉ cần tạo ra 1 thay đổi nhỏ trong S-box cũng có thể làm suy yếu đáng kể sức mạnh và sự bảo mật của DES.

Cấu tạo của S-box đã gây ra tranh cãi rất mạnh mẽ suốt từ 70s – 90s của thế kỷ 20 về khả năng NSA còn che giấu 1 Backdoor giúp cho việc phá giải mã dễ dàng hơn bình thường (giảm không gian khóa xuống dướiđể có thể Bruteforce (vét cạn) nhanh hơn. Đặc biệt, sau khi có sự khám phá về hình thức sử dụng “” (Differential cryptanalysis) đã củng cố niềm tin rằng nghi ngờ này là có khả năng. Cụ thể Biham và Shamir đã chứng minh rằng chỉ cần tạo ra 1 thay đổi nhỏ trong S-box cũng có thể làm suy yếu đáng kể sức mạnh và sự bảo mật của DES.

Thuật toán sinh và giải mã DES

(L

i

R

i

= (

R

i – 1, 

L

i – 1

 𐌈 f(

R

i – 1

L

i

)

)

Quay trở lại DES, mỗi vòng lặp của DES sẽ thực hiện công thức:

(L

i

R

i

= T ⋄ F(

R

i – 1

K

i

)

Trong đó, 

F

i

 là phép thay thế 

L

i – 1

 bằng 

L

i – 1

 𐌈 f(

R

i – 1

L

i

)

, còn T là phép đổi chỗ hai thành phần L và R. Tức là mỗi biến đổi vòng lặp DES có thể coi là một tích hàm số của F và T. Trừ vòng lặp cuối cùng là ko có T vì ko xảy ra đổi chỗ L và R. Do đó có thể biểu diễn toàn bộ quá trình mã hóa DES thành công thức tích hàm số sau:

DES = IC

1

F

16

T

F

15

T

 … 

F

2

T

F

1

(IC)

Khi đó, thuật toán giải mã DES sẽ được thực hiện theo thứ tự ngược lại, các khóa con cũng sẽ được sử dụng theo thứ tự ngược lại tương ứng.

DES

1

 = IC

1

F

1

T

F

2

T

 … 

F

15

T

F

16

(IC)

Chú ý rằng mỗi hàm T hay F đều là các hàm đối hợp (tức là f(f(x)) = x, hay f =

f

1

), nên DES

DES

1

 hay 

DES

1

DES cũng đều ra bản rõ ban đầu cả, chỉ yêu cầu thứ tự sử dụng chuỗi khóa con là khác nhau. 

Ngoài ra cũng có thể biểu diễn ngắn gọn lại như sau:Trong đó,là phép thay thếbằng, còn T là phép đổi chỗ hai thành phần L và R. Tức là mỗi biến đổi vòng lặp DES có thể coi là một tích hàm số của F và T. Trừ vòng lặp cuối cùng là ko có T vì ko xảy ra đổi chỗ L và R. Do đó có thể biểu diễn toàn bộ quá trình mã hóa DES thành công thức tích hàm số sau:

Các mở rộng 2-DES và 3-DES cùng nguy cơ Meet-in-the Middle Attack.

Như ở đầu phần trước, tôi cũng đã nói rằng trong 64 bit của khóa chính, thực chất chỉ có 56 bit là được sử dụng thật vào việc sinh khóa con. Do đó, kích thước khóa thực tế chỉ có độ dài 56, nên không gian (không gian mẫu) tìm kiếm khóa sẽ có độ lớn là 

2

56

.

1 khối DES sẽ có độ dài khóa là 56, vậy phải chăng 2 khối DES (2-DES) sẽ có độ dài khóa là 2 * 56 = 112 (bit)? Không, that is “cú lừa” đó! Thực chất độ dài khóa chỉ là 57 bit!

Giả sử với 2 khối DES có khóa tương ứng là k

1

 và k

khác nhau, p là bản rõ (plain text) cần mã hóa. Khi đó, ta sẽ có sơ đồ các bản tin thu được qua 2 lần mã hóa bằng DES là:

p →DES(

k

1

, p) → DES(

k

2

, DES(

k

1

, p)) = c

c → DES

1

(

k

2

, c) =DES

1

(

k

2

, DES(

k

2

, DES(

k

1

, p))) = DES(

k

1

, p) 

Hãy chú ý đến kết quả sau: 

DES

1

(

k

2

, c) =

 DES(

k

1

, p)

Sau đó thì sao, đơn giản thôi, tiến hành matching 2 bảng kết quả đầu ra trên. Thủ tục matching này tuy có độ phức tạp tính toán là 

2

112

, nhưng độ phức tạp bảo mật lại chỉ là 0; do đó độ phức tạp bảo mật sẽ tăng lên thành O(k * 

2

57

) =  O(

2

57

). 

Sau khi matching xong, ta sẽ được 1 giao điểm duy nhất! Giao điểm này sẽ cho ta biết giá trị 2 khóa k

1

 và k

2

. Vậy là DES bị phá giải với độ dài không gian khóa chỉ là 57 chứ không phải 112 như ta “tưởng“!

Nghe có vẻ sida nhỉ? Đúng vậy, tuy 2-DES không đem lại nhiều hiệu quả hơn so với DES; nhưng 3-DES thì thực sự đem lại một giải pháp an toàn bảo mật với độ phức tạp 112 bit. Cụ thể, ta có thể xem 2 sơ đồ mã hóa sau:

3 khóa: 

DES(

k

3

, DES

1

(

k

2

, DES(

k

1

, p)))

2 khóa: DES(k

1

, DES

1

(

k

2

, DES(

k

1

, p)))

Lý do để thực hiện DES

1

 ở bước 2 là vì trong thực tế, người ta chỉ sử dụng DES và 3-DES, nhưng không phải toàn bộ các module khác nhau của hệ thống cũng đều được thống nhất sử dụng DES hoặc 3-DES từ trước; nhất là việc tích hợp 2 hệ thống từ 2 hãng khác nhau lại với nhau. Do đó để đơn giản hóa mà ko làm giảm tính bảo mật của DES, người ta quy ước thực hiện DES

1

 ở bước thứ 2. Khi đó nếu k

1

 = k

2

, hệ thống DES trở thành chỉ có 2 khóa tồn tại; và sẽ trở về tương đương như 1-DES vậy.

Lý do để thực hiện DESở bước 2 là vì trong thực tế, người ta chỉ sử dụng DES và 3-DES, nhưng không phải toàn bộ các module khác nhau của hệ thống cũng đều được thống nhất sử dụng DES hoặc 3-DES từ trước; nhất là việc tích hợp 2 hệ thống từ 2 hãng khác nhau lại với nhau. Do đó để đơn giản hóa mà ko làm giảm tính bảo mật của DES, người ta quy ước thực hiện DESở bước thứ 2. Khi đó nếu k= k, hệ thống DES trở thành chỉ có 2 khóa tồn tại; và sẽ trở về tương đương như 1-DES vậy.

Ứng dụng của các thuật toán DES.

DES và 3-DES được sử dụng thực tế trong các giao thức bảo mật tầng TCP là SSL và TLS (Secure socket layer và Transport layer security). DES tuy ko mạnh, nhưng đơn giản, đảm bảo realtime trong việc mã hóa và giải mã dữ liệu ở Tầng Giao vận. Và đây chính là nguồn gốc của giao thức HTTPS. Chữ “S” ở đây có nghĩa là SSL hoặc TLS.

Với không gian khóa có độ lớn 

2

56

, nếu biết 1 cặp (bản mã, bản rõ), giả sử một PC thông thường 1 core 1 thread thực hiện phép thử với 1 trường hợp khóa tốn 10

-6

 giây, thì máy PC đó sẽ tốn 10

11

 năm để vét cạn hết toàn bộ không gian khóa và phá thành công 1-DES.

Tuy nhiên, PC đó chỉ là 1 máy tính thông thường. Ngày này, với sức mạnh của vi xử lý máy tính hiện đại, công nghệ ghép nối song song vi xử lý, tính toán phân tán, cộng thêm các kỹ thuật lập trình song song, cũng như việc khai thác Bộ vi xử lý đồ họa (GPU – Graphic Processor Unit); nên nếu muốn phá DES, cũng không phải bất khả thi đến 10

11

 năm như cuối thế kỷ 20.

Sau khi trở lên thịnh hành được 2 thập kỷ, DES đã bộc lộ nhiều yếu điểm và kém tin tưởng như mình đã đề cập bên trên; do đó ứng dụng hiện nay của nó chỉ có vỏn vẹn trong 1 số khía cạnh trên thôi. Còn việc sử dụng làm “khóa phiên” như trong giao thức Needham – Schroeder thì nó ko còn chỗ nữa. Sau DES, người ta đã phát triển và đưa vào sử dụng thuật toán AES (Advance Encryption Standard) vì tốc độ xử lý cũng như tính tin cậy. Mình sẽ viết một bài riêng về AES sau.

Kỹ Thuật Giải Phương Trình Hàm / 2023

Published on

kỹ thuật giải phương trình hàm

3. 1 PHƯƠNG PHÁP THẾ BIẾN Hint: 1. Tính f(0) 2. Thế y = −1, chứng minh f là hàm lẻ 3. Thế y = 1 ⇒ f(2x + 1) = 2f(x) + 1 4. Tính f(2(u + v + uv) + 1) theo (3) và theo giả thiết để suy ra f(2uv + u) = 2f(uv) + f(u) 5. Cho v = −1 2 , u 2 → x và u → y, 2uv → x để suy ra điều phải chứng minh Ví dụ 1.4. Tìm tất cả các hàm số f : R → R đồng thời thỏa mãn các điều kiện sau: f(x) = xf 1 x , ∀x = 0 f(x) + f(y) = 1 + f(x + y), ∀x, y ∈ R, (x, y) = (0, 0); x + y = 0 Hint: 1. Tính f(0), f(−1) 2. Tính a + 1 với a = f(1) = f € x+1 x+1 Š = f € x + 1 1 x+1 Š theo cả hai điều kiện. Đáp số: f(x) = x + 1 Nhận xét: Thủ thuật này áp dụng cho một lớp các bài toán gần tuyến tính Ví dụ 1.5. Tìm tất cả các hàm số f : R+ → R thỏa f(1) = 1 2 và f(xy) = f(x)f ‚ 3 y Œ + f(y)f 3 x , ∀x, y ∈ R+ Hint: 1. Tính f(3) 2. Thế y → 3 x Đáp số: f(x) = 1 2 Ví dụ 1.6. Tìm tất cả các hàm số f : R∗ → R thỏa mãn điều kiện: f(x) + 2f 1 x = 3x, ∀x ∈ R∗ Hint: Thế x → 1 x Đáp số: f(x) = 2 x − x Ví dụ 1.7. Tìm tất cả các hàm số f : R{0, 1} → R thỏa mãn điều kiện: f(x) + f x − 1 x = 2x, ∀x, ∈ R{0, 1} Hint: Thế x → x−1 x , x → −1 x−1 Đáp số: f(x) = x + 1 1−x − x−1 x Luyện tập: 2. Tìm tất cả các hàm số f : Q+ → Q+ thỏa mãn điều kiện: f(x + 1) = f(x) + 1, ∀x ∈ Q+ và f(x3 ) = f3 (x), ∀x ∈ Q+ GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

4. 1 PHƯƠNG PHÁP THẾ BIẾN Hint: 1. Quy nạp f(x + n) = f(x) + n, ∀x ∈ Q+ , ∀n ∈ N 2. Với p q ∈ Q+ , tính f p q + q2 3 ‹ theo hai cách. Đáp số: f(x) = x, ∀x ∈ Q+ Ví dụ 1.8. (VMO 2002). Hãy tìm tất cả các hàm số f(x) xác định trên tập số thực R và thỏa mãn hệ thức f (y − f(x)) = f € x2002 − y Š − 2001.y.f(x), ∀x, y ∈ R. (1) Giải a) Thế y = f(x) vào (1) ta được f(0) = f € x2002 − f(x) Š − 2002. (f(x))2 , ∀x ∈ R. (2) b) Lại thay y = x2002 vào (1) thì f € x2002 − f(x) Š = f(0) − 2001.x2002 .f(x), ∀x ∈ R. (3) Lấy (2) cộng với (3) ta được f(x) € f(x) + x2002 Š = 0, ∀x ∈ R. Từ đây suy ra với mỗi giá trị x ∈ R thì ta có hoặc là f(x) = 0 hoặc là f(x) = −x2002 . Ta sẽ chỉ ra rằng để thỏa mãn yêu cầu bài toán thì bắt buộc phải có đồng nhất f(x) ≡ 0, ∀x ∈ R hoặc f(x) ≡ −x2002 , ∀x ∈ R. Thật vậy, vì f(0) = 0 trong cả hai hàm số trên, nên không mất tính tổng quát ta có thể giả sử tồn tại a = 0 sao cho f(a) = 0, và tồn tại b 0 sao cho f(b) = −b2002 (vì chỉ cần thay x = 0 vào quan hệ (1) ta nhận được hàm f là hàm chẵn). Khi đó thế x = a và y = −b vào (1) ta được f(−b) = f € a2002 + b Š . Vậy ta nhận được dãy quan hệ sau 0 = −b2002 = f(b) = f(−b) = f € a2002 + b Š = 0(mâu thuẫn vì 0 = 0) − (a2002 + b) 2002 (mâu thuẫn vì − (a2002 + b) 2002 −b2002 ) . Bằng cách thử lại quan hệ hàm ban đầu ta kết luận chỉ có hàm số f(x) ≡ 0, ∀x ∈ R thỏa mãn yêu cầu bài toán. Ví dụ 1.9. (Hàn Quốc 2003) Tìm tất cả các hàm số f : R → R thỏa mãn f (x − f(y)) = f(x) + xf(y) + f (f(y)) , ∀x, y ∈ R. (4) GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

6. 1 PHƯƠNG PHÁP THẾ BIẾN Ví dụ 1.10. (Iran 1999) Xác định các hàm số f : R → R thỏa mãn f (f(x) + y) = f € x2 − y Š + 4yf(x), ∀x, y ∈ R. Giải a) Thế y = x2 ta được f € f(x) + x2 Š = f(0) + 4×2 f(x), ∀x ∈ R. b) Thế y = −f(x) ta được f(0) = f € f(x) + x2 Š − 4 (f(x))2 , ∀x ∈ R. Cộng hai phương trình trên ta được 4f(x) € f(x) − x2 Š = 0, ∀x ∈ R. Từ đây ta thấy với mỗi x ∈ R thì hoặc là f(x) ≡ 0 hoặc là f(x) = −x2 . Ta chứng minh nếu hàm f thỏa mãn yêu cầu bài toán thì f phải đồng nhất với hai hàm số trên. Nhận thấy f(0) = 0, từ đó thay x = 0 ta được f(y) = f(−y), ∀y ∈ R, hay f là hàm chẵn. Giả sử tồn tại a = 0, b = 0 sao cho f(a) = 0, f(b) = −b2 , khi đó thay x = a, y = −b ta được f(−b) = f(a2 + b) → f(b) = f(a2 + b). Từ đó ta có quan hệ sau 0 = −b2 = f(b) = f(−b) = f € a2 + b Š = 0(mâu thuẫn vì 0 = 0) − (a2 + b) 2 (mâu thuẫn vì − (a2 + b) 2 −b2 ) . Do đó xảy ra điều mâu thuẫn. Thử lại thấy hàm số f(x) ≡ 0 thỏa mãn yêu cầu. Nhận xét: 1. Rõ ràng bài toán VMO 2002 có ý tưởng giống bài toán này. 2. Ngoài phép thế như trên thì bài toán này ta cũng có thể thực hiện những phép thế khác như sau: a) Thế y = 1 2 € x2 − f(x) Š . b) Thế y = 0 để có f (f(x)) = f (x2 ), sau đó thế y = x2 − f(x). c) Thế y = x − f(x) và sau đó là y = x2 − x. Ví dụ 1.11. Tìm hàm số f : R → R thỏa mãn điều kiện: f (x − f(y)) = 2f(x) + x + f(y), ∀x, y ∈ R. (6) Giải GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

9. 1 PHƯƠNG PHÁP THẾ BIẾN Vậy f(x) = −f(x), ∀x ∈ R, từ điều này kết hợp với (9) ta có f(0) (f(x) − 1) = 0, ∀x ∈ R. Từ đây suy ra f(0) = 0, vì nếu ngược lại thì f(x) = 1, ∀x = 0, trái với điều kiện f là hàm lẻ. Từ đây ta nhận được quan hệ quen thuộc (f(x))2 = x2 , ∀x ∈ R. Giả sử tồn tại x0 ∈ R sao cho f (x0) = x0, khi đó trong (*) ta có x0 = f (x0) = −f (f(x0)) = −f(x0) = x0, vô lý. Vậy chứng tỏ f(x) = −x, ∀x ∈ R. Thử lại thấy hàm này thỏa mãn bài toán. Nhận xét: Bài toán trên cho kết quả là hàm chẵn f(x) = −x. Nếu vẫn giữa nguyên vế phải và để nhận được hàm lẻ f(x) = x, ta sửa lại dữ kiện trong vế trái như trong ví dụ sau Ví dụ 1.14. Tìm tất cả các hàm số f : R → R thỏa mãn điều kiện f (f(x) − y) = f(x) − f(y) + f(x)f(y) − xy, ∀x, y ∈ R. Giải a) Thế y = 0 ta được f (f(x)) = f(x) − f(0) + f(0).f(x), ∀x ∈ R. (10) b) Thế y = f(x) và sử dụng kết quả trên, ta được f(0) = f(x) − f (f(x)) + f(x).f (f(x)) − xf(x) (∗) = f(0) − 2f(0).f(x) + (f(x))2 + f(0). (f(x))2 − xf(x), hay −2f(0).f(x) + (f(x))2 + f(0). (f(x))2 − xf(x) = 0, ∀x ∈ R. c) Thế x = 0 vào đẳng thức trên ta được (f(0))2 − (f(0))2 = 0 → f(0) = 0 hoặc f(0) = 1. d) Nếu f(0) = 0 thì thay vào (10) ta có f (f(x)) = f(x), ∀x ∈ R, thay kết quả này vào trong (*) ta có f(x) = x. e) Nếu f(0) = 1 thay vào (10) ta có f (f(x)) = 2f(x) − 1, thay vào trong (*) ta có f(x) = 1 2 x + 1. Kết luận: Thay vào ta thấy chỉ có hàm số f(x) = x, ∀x ∈ R là thỏa mãn yêu cầu. Ví dụ 1.15. (AMM,E2176). Tìm tất cả các hàm số f : Q → Q thỏa mãn điều kiện f(2) = 2 và f ‚ x + y x − y Œ = f(x) + f(y) f(x) − f(y) , ∀x = y. Giải GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

10. 1 PHƯƠNG PHÁP THẾ BIẾN Ta sẽ chứng minh f(x) = x là nghiệm duy nhất của bài toán dựa vào một chuỗi các sự kiện sau. Trước tiên nhận thấy f không thể là hàm hằng. a) Tính f(0), f(1). Thay y = 0 ta nhận được f(1) = f(x) + f(0) f(x) − f(0) → (f(1) − 1) f(x) = f(0) (1 + f(1)) , ∀x ∈ Q. Suy ra f(1) = 1, f(0) = 0. b) Hàm f là hàm lẻ. Thay y = −x ta có 0 = f(0) = f(x) + f(−x) → f(−x) = −f(x), ∀x ∈ Q. c) Thay y = cx, c = 1, x = 0 ta có f(x) + f(cx) f(x) − f(cx) = f 1 + c 1 − c = 1 + f(c) 1 − f(c) , suy ra f(cx) = f(c).f(x), lấy c = q, x = p q thì ta được f ‚ p q Œ = f(p) f(q) Ví dụ 1.16. Tìm tất cả các hàm số f : R → R thỏa mãn f € (x − y)2 Š = (f(x))2 − 2xf(y) + y2 , ∀x, y ∈ R. Giải Thay x = y = 0 thì (f(0)) = (f(0))2 → f(0) = 0 hoặc f(0) = 1. 1. Nếu f(0) = 0, thì thay x = y vào điều kiện ban đầu ta được f(0) = (f(x))2 − 2xf(x) + x2 = (f(x) − x)2 → f(x) = x, ∀x ∈ R. Nhận thấy hàm số này thỏa mãn. 2. Nếu f(0) = 1 thì lại vẫn thay x = y = 0 ta nhận được, với mỗi x ∈ R thì hoặc là f(x) = x + 1 hoặc f(x) = x − 1. Giả sử tồn tại giá trị a sao cho f(a) = a − 1. Khi đó thay x = a, y = 0 ta được f € a2 Š = a2 − 4a + 1. Nhưng ta lại có hoặc là f (a2 ) = a2 + 1 hoặc là f (a2 ) = a2 − 1. Do đó ta phải có hoặc là a2 − 4a + 1 = a2 + 1 hoặc a2 − 4a + 1 = a2 − 1, tức a = 0 hoặc là a = 1 2 . Tuy nhiên kiểm tra đều không thỏa. Vậy hàm số thỏa mãn yêu cầu là f(x) = x, ∀x ∈ R hoặc là f(x) = x + 1, ∀x ∈ R. Ví dụ 1.17. (THTT T9/361) Tìm tất cả các hàm số f : R → R thỏa mãn điều kiện f € x3 − y Š + 2y € 3 (f(x))2 + y3 Š = f (x + f(y)) , ∀x, y ∈ R. GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

11. 1 PHƯƠNG PHÁP THẾ BIẾN Giải a) Thay y = x3 ta có f(0) + 2×3 € 3 (f(x))2 + x6 Š = f € x3 + f(x) Š , ∀x ∈ R. b) Thay y = −f(x) ta được f € x3 + f(x) Š − 2f(x) € 3 (f(x))2 + (f(x))2 Š = f(0), ∀x ∈ R. Từ hai đẳng thức trên ta được 2×3 € 3 (f(x))2 + x6 Š = 8 (f(x))3 , ∀x ∈ R. Do đó 0 = 4 (f(x))2 − x3 € 3 (f(x))2 + x6 Š = € 4 (f(x))3 − 4 (f(x))2 .x3 Š + € (f(x))2 .x3 − x9 Š = € f(x) − x3 Š € 4 (f(x))2 + x3 € f(x) + x3 ŠŠ = € f(x) − x3 Š ‚ 2f(x) + x3 4 Œ2 + 15 16 x6 ! . Chú ý rằng ‚ 2f(x) + x3 4 Œ2 + 15 16 x6 = 0 thì x = 0, f(0) = 0. Bởi vậy trong mọi trường hợp ta đều có f(x) = x3 . Thử lại thấy hàm số này thỏa mãn bài toán. GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

13. f 1 qn .qn.xn

19. ≤ N. Vì 1 r ∈ Q nên

23. 2 PHƯƠNG TRÌNH HÀM CAUCHY liên tục thỏa mãn f € x+y 2 Š = 2f(x)f(y) f(x)+f(y) (8) là f(x) = 1 b , b 0 Chứng minh Chỉ cần đặt g(x) = 1 f(x) , ta nhận được quan hệ hàm Jensen theo hàm g(x) nêng(x) = cx + d. Do đó f(x) = 1 cx+d . Tuy nhiên hàm số này cần phải thỏa mãn điều kiện f(x) ∈ R+ nên: 1 cx+d 0, ∀x ∈ R ⇒c = 0, b 0, vậy hàm thu được là f(x) = 1 b , b 0 tùy ý. Lại vẫn trong quan hệ hàm Jensen nếu ta thực hiện phép bình phương vào hàm số thì ta nhận ngay được hệ quả sau: Hệ quả 9. Hàm số f(x)liên tục trên R thỏa f € x+y 2 Š = q [f(x)]2 +[f(y)]2 2 (9) là f(x) = c với c ≥ 0. Chứng minh Từ quan hệ hàm số suy ra f(x) ≥ 0, ∀x ∈ R. Ta có: € f € x+y 2 ŠŠ2 = [f(x)]2 +[f(y)]2 2 . Đặt g(x) = [f(x)]2 thì ta nhận được quan hệ hàm Jensen cho hàm g(x)nên g(x) = ax + b. Do đó f(x) = √ ax + b. Mà theo điều kiện thì √ ax + b ≥ 0, ∀x ∈ R ⇒ a = 0, b ≥ 0 Ta được hàm f(x) = b, b ≥ 0. Từ quan hệ hàm trong hệ quả 6, nếu ta thực hiện phép nâng lũy thừa lên cơ số e(đối với biến) thì ta có: f e x+y 2 = È f(ex)f(ey) ⇒ f( √ chúng tôi = È f(ex)f(ey) Thay ngược lại biến dạ ng bình thường ta nhận được kết quả: Hệ quả 10. Hàm số f(x) xác định và liên tục trên R+ thỏa f( √ xy) = È f(x)f(y), ∀x, y ∈ R+ (10) là: f(x) ≡ 0 f(x) = chúng tôi , a ∈ R, c 0 Chứng minh Đặt x = eu , y = ev , f(eu ) = g(u) thì ta nhận được: g € u+v 2 Š = È g(u)g(v), theo hệ quả 6 thì: g(u) ≡ 0 g(u) = eau + b . Vậy 2 4 f(x) ≡ 0 f(x) = ea ln x+b = chúng tôi , c 0, a ∈ R . Trong quan hệ hàm của hệ quả 5, nếu ta thực hiện theo quan hệ hàm bình phương, tức là f2 ( √ xy) = f2(x)+f2(y) 2 , thực hiện căn bậc hai hai vế ta được hệ quả 11. Hệ quả 11. Hàm số f(x) xác định và liên tục trên R+ thỏa f( √ xy) = q f2(x)+f2(y) 2 , ∀x, y ∈ R+ (11) là f(x) ≡ c, c ≥ 0 Chứng minh Từ giả thiết của hàm dễ thấy f(x) ≥ 0, ∀x ∈ R+ . Đặt x = eu , y = ev , [f(eu )]2 = g(u). Khi đó g(u) ≥ 0, và ta có: g € u+v 2 Š = g(u)+g(v) 2 , ∀u, v ∈ R Vậy g(u) = au + b. Để g(u) ≥ 0, ∀u ∈ Rthì a = 0, b ≥ 0. Do đó f(x) ≡ c, c ≥ 0. Lại từ quan hệ hàm Jensen f € x+y 2 Š = f(x)+f(y) 2 , ta xét phép gán hàm f(x) = g € 1 x Š thì ta nhận được quan hệ hàm số: g 1 (x+y)/2 = g(1 x )+g(1 y ) 2 ⇔ g 2 x+y = g(1 x )+g(1 y ) 2 , thay ngược trở lại biến bình thường ta được: Hệ quả 12. Hàm số f(x) liên tục trên R{0} thỏa mãn f „ 2 1 x + 1 y Ž = f(x) + f(y) 2 , ∀x, y, x + y = 0 (12) là hàm số f(x) = a x + b; a, b ∈ R tùy ý. Giải Với cách thiết lập như trên thì ta có g(x) = ax + b, với g(x) = f € 1 x Š , khi đó thì f(x) = a x + b; a, b ∈ R. Lại từ quan hệ hàm Jensen f € x+y 2 Š = f(x)+f(y) 2 , ta xét phép gán hàm f(x) = 1 g(1 x ) thì ta nhận được quan hệ hàm: 1 g 1 x+y 2 ‹ = 1 g(1 x ) + 1 g(1 y ) 2 = g € 1 x Š + g 1 y 2g € 1 x Š g 1 y ⇔ g ‚ 2 x + y Œ = 2g € 1 x Š g 1 y g € 1 x Š + g 1 y = 2 1 g(1 x ) + 1 g(1 y ) Thay ngược lại biến ta được: Hệ quả 13. Hàm số f(x) xác định liên tục trên R{0} thỏa f 2 1 x + 1 y ‹ = 2 1 f(x) + 1 f(y) (13) là 2 6 6 4 f(x) = x a , a = 0 f(x) = 1 b , b = 0 . Bằng cách thực hiện các phép toán khai căn, nâng lũy thừa, logarit GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

24. 2 PHƯƠNG TRÌNH HÀM CAUCHY Nepe như trong các phần trước ta thu được các kết quả tương tự sau: Hệ quả 14. Hàm số f(x) xác định liên tục trên R{0} thỏa f 2 1 x + 1 y ‹ = È f(x)f(y), ∀x, y, x + y = 0(14) là: 2 4 f(x) ≡ 0 f(x) = e a x +b , a, b ∈ R Hệ quả 15. Hàm số f(x) xác định liên tục trên R{0} thỏa f 2 1 x + 1 y ‹ = q [f(x)]2 +[f(y)]2 2 , ∀x, y, x + y = 0 (15) là: f(x) ≡ c, c ≥ 0 tùy ý. Hệ quả 16. Các hàm f(x) ≥ 0 xác định liên tục trên R+ thỏa f √ x2+y2 2 = q [f(x)]2 +[f(y)]2 2 , ∀x, y ∈ R+ (16) là: f(x) = √ ax2 + b với a, b ≥ 0 tùy ý. Hệ quả 17. Các hàm số f(x) xác định, liện tục trên R và thỏa f √ x2+y2 2 = f(x)+f(y) 2 , ∀x, y ∈ R (17) là: f(x) = ax2 + b; ∀a, b ∈ R Hệ quả 18. Các hàm số f(x) xác định, liện tục trên R thỏa f √ x2+y2 2 = È f(x)f(y), ∀x, y ∈ R (18) là: 2 4 f(x) ≡ 0 f(x) = eax2+b ; ∀a, b ∈ R Hệ quả 19. Các hàm số f(x) xác định, liện tục trên R thỏa f √ x2+y2 2 = 2 1 f(x) + 1 f(y) , ∀x, y ∈ R (19) là: f(x) = 1 ax2+b với ab ≥ 0, b = 0 tùy ý. IV. Các bài tập vận dụng Bài toán 1. Tìm tất cả các hàm f(x) liên tục trên R thỏa: f(x + y) = f(x)+f(y)+f(x)f(y) Giải: Từ bài toán ta có: f(x+y)+1 = (f(x)+1)(f(y)+1) nên đặt g(x) = f(x)+1 thì ta có g(x+y) = g(x).g(y) ⇒ g(x) = ax vậy f(x) = ax −1. Bài toán 2. Tìm tất cả các hàm số f(x) liên tục trên R thỏa mãn điều kiện:f(x)+f(y)−f(x+y) = xy, ∀x, y ∈ R Giải Ta có thể viết lại phương trình hàm dưới dạng: f(x) + f(y) − f(x + y) = 1 2 [(x + y)2 − (x2 + y2 )] ⇔ f(x) + 1 2 x2 + f(y) + 1 2 y2 = f(x + y) + 1 2 (x + y)2 Đặt g(x) = f(x) + 1 2 x2 thì ta có g(x) là hàm liên tục trên R thỏa mãn điều kiện: g(x)+g(y) = g(x+y) Vậy g(x) = ax, ∀x ∈ R, a là một hằng số thực, nên f(x) = −1 2 x2 +ax. Thử lại thấy hàm này thỏa mãn yêu cầu bài toán. Bài toán 3. Cho a ∈ R, tìm tất cả các hàm liên tục f : R → R sao cho: f(x−y) = f(x)−f(y)+axy, ∀x, y ∈ R Giải Cho x = 1, y = 0 ⇒ f(1) = f(1) − f(0) nên f(0) = 0. Lại cho x = y = 1 ⇒ f(0) = f(1) − f(1) + a ⇒ a = 0. Vậy với a = 0 thì không tồn tại hàm số. Ta viết lại quan hệ hàm f(x − y) = f(x) − f(y), ∀x, y ∈ R Từ đây ta được: f(x) = f(x + y − y) = f(x + y) − f(y) ⇒ f(x + y) = f(x) + f(y), x, y ∈ R Vậy f(x) = ax, ∀x ∈ R Bài toán 4. Tìm tất cả các hàm số f(x) xác định liên tục trên R+ thỏa mãn điều kiện:f x y = f(x) − f(y) ∀x, y ∈ R+ Giải Đặt x y = t → x = ty thay vào ta có: f(t) = f(ty) − f(y) ⇒ f(ty) = f(t) + f(y). Vậy f(x) = a ln x ∀x ∈ R+ , a ∈ R. Bài toán 5. Cho a, b ∈ R{0}, tìm các hàm f(x) xác định liên tục trên R và thỏa mãn điều kiện: f(ax + by) = af(x) + bf(y) ∀x, y ∈ R(1) Giải Cho x = y = 0 vào (1) ta được: f(0)(a + b − 1) = 0 Nếu a + b = 1 thì f(0) = 0. Vậy điều kiện Cauchy được thỏa mãn, nên khi đó thì f(ax) = af(x) và f(bx) = bf(x), và ta có quan hệ f(ax + by) = f(ax) + f(by), ∀x, y ∈ R. Vậy f(x) = x. Nếu a + b = 1 thì nhận giá trị tùy ý, vậy ta phải đặt một hàm mới để được quan hệ Cauchy là g(x) = f(x) − f(0) thì g(0) = 0 và tương tự như phần trình bày trên ta có f(x) = cx + d Vậy: f(ax + by) = af(x) + bf(y) ∀x, y ∈ R là: a + b = 1 ⇒ f(x) = cx, c ∈ R a + b = 1 ⇒ f(x) = cx + d, c, d ∈ R Nhận xét: Với cách làm tương tự cho quan hệ f(ax + by) = af(x) + bf(y) Bài toán 6. Xác định các hàm số f liên tục trên R thỏa mãn điều kiện:f(2x − y) = 2f(x) − f(y), ∀x, y ∈ R Giải Đặt g(x) = f(x) − f(0) thì g(0) = 0, từ phương trình trên ta thu được: g(2x − y) = 2g(x) − g(y), ∀x, y ∈ R Cho y = 0 ⇒ g(2x) = 2g(x) và cho x = 0 ⇒ g(−y) = −g(y). Thay vào trên ta được: g(2x − y) = g(2x) − g(y), ∀x, y ∈ R Vậy g(x+y) = g € 2.x 2 − 1. y −1 Š = g(x)−g(−y) = g(x)+g(y), ∀x, y ∈ R. Do đó: g(x) = ax, x ∈ R, a là số thực GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

25. 2 PHƯƠNG TRÌNH HÀM CAUCHY tùy ý. Vậy f(x) = ax+b, thử lại thấy hàm này thỏa mãn yêu cầu bài toán. Bài toán 8(Đề nghị IMO 1979). Chứng minh rằng mọi hàm f : R → R thỏa mãn điều kiện: f(xy+x+y) = f(xy)+f(x)+f(y), ∀x, y ∈ R khi và chỉ khi f(x + y) = f(x) + f(y), ∀x, y ∈ R Giải Dễ thấy nếu f tuyến tính thì f thỏa mãn hệ thức đầu tiên. Giả sử f(xy + x + y) = f(xy) + f(x) + f(y), ∀x, y ∈ R đặt y = u + v + uv ta được: f(x+u+v +xu+xv +uv +xuv) = f(x)+f(u+v +uv)+f(xu+xv +xuv) Hoán đổi vai trò của x và u ta được: f(u + x + v + ux + uv + xv + uxv) = f(u) + f(x + v + xv) + f(ux + uv + uxv) So sánh hai đẳng thức trên ta được: f(x) + f(u + v + uv) + f(xu + xv + xuv)= f(u) + f(x + v + xv) + f(ux + uv + uxv) Hay f(uv) + f(xu + xv + xuv) = f(xv) + f(xu + uv + xuv) Lấy x = 1 ta có f(u) + 2f(uv) = f(u + 2uv), theo ví dụ 4 ta có điều phải chứng minh. Bài toán 9. Tìm tất cả các hàm số f(x) liên tục trên R thỏa mãn điều kiện:f(x)f(y) − f(x + y) = sin x. sin y, ∀x, y ∈ R Giải Thay y = 0 ta có f(x)[f(0) − 1] = 0 ⇒ f(0) = 1, vì dễ dàng nhận thấy f(x) ≡ 0, ∀x ∈ R không là nghiệm của phương trình. Thay y = −x ta nhận được: f(x)f(−x) − f(0) = −sin2 x, ∀x ∈ R ⇒ f(x)f(−x) = 1 − sin2 x = cos2 x, ∀x ∈ R(1). Thay x = π 2 vào (1) ta được nên: f € π 2 Š .f € −π 2 Š = 0 Hoặc f € π 2 Š = 0 thay vào hàm ta được: −f € x + π 2 Š = sin x ⇒ f € x + π 2 Š = − sin x → f(x) = − sin € x − π 2 Š = cos x, ∀x ∈ R Hoặc f € −π 2 Š = 0 thay vào hàm ta được: f € x − π 2 Š = sin x ⇒ f (x) = sin € x + π 2 Š = cos x, ∀x ∈ R Dễ dàng kiểm tra lại thấy f(x) = cos x là hàm thỏa mãn yêu cầu bài toán. Bài toán 10. Tìm tất cả các hàm số f : R → R thỏa mãn f(x + y − xy) + f(xy) = f(x) + f(y) (1) với mọi x, y ∈ R. Giải Ta chứng minh nếu f là hàm số thỏa mãn điều kiện bài toán thì hàm số F(x) = f(x + 1) − f(x) sẽ thỏa mãn điều kiện hàm Cauchy F(u + v) = F(u) + F(v) với mọi (u, v) ∈ ∆ = {(u, v) : u + v 0hoặc u = v = 0 hoặc u + v ≤ −4} Thật vậy, giả sử flà hàm số thỏa mãn điều kiện (1). Ta định nghĩa hàm số f∗ (x, y) bởi: f∗ (x, y) = f(x) + f(y) − f(xy) Dễ thấy rằng hàm f∗ thỏa mãn phương trình hàm: f∗ (xy, z)+f∗ (x, y) = f∗ (x, yz)+f∗ (y, z)(1) Mặt khác ta có f∗ (x, y) = f(x+y −xy)(2) Thay (2) vào (1) ta được: f xy + 1 y − x + f(x + y − xy) = f(1) + f y + 1 y − 1 , với mọi x, y = 0 Đặt xy + 1 y − x = u + 1 và x + y − xy = v + 1(3) ta nhận được: f(u + 1) + f(v + 1) = f(1) + f(u + v + 1), với mọi u, v thỏa mãn điều kiện trên. Bằng việc cộng hai đẳng thức của (3) ta có y + 1 y = u + v + 2, để có nghiệm y = 0 chỉ trong trường hợp D = {(u + v + 2)2 − 4 = (u + v)(u + v + 4) ≥ 0}. Điều kiện này xảy ra khi và chỉ khi hoặc là u + v 0 hoặc u + v = 0 hoặc u + v + 4 ≤ 0. Bằng việc kiểm tra điều kiện ta thấy bài toán được thỏa. Nếu f là một nghiệm của bài toán thì f phải có dạng f(x) = F(x − 1) + f(1)(1) với mọi x, trong đó F thỏa mãn phương trình hàm Cauchy F(x + y) = F(x) + F(y) với mọi x, y. Chứng minh Theo chứng minh trên, thì fcó dạng với F thỏa mãn phương trình Cauchy với mọi (u, v) ∈ ∆. Ta sẽ chứng minh rằng Fthỏa mãn phương trình Cauchy với mọi (u, v) bất kỳ. Giả sử , khi đó tồn tại một số thực sao cho các điểm (x, u), (x + u, v), (x, u + v) nằm trong ∆ với việc xác định x là: cố định (u, v) ∈ ∆ thì từ các bất đẳng thức x + u 0, x + u + v 0 ta tìm được điều kiện của x. Nhưng khi đó: F(u) = F(x + u) − F(x) F(v) = F(x + u + v) − F(x + u) F(u + v) = F(x + u + v) − F(x) Suy ra từ các phương trình này ta có F(u) + F(v) = F(u + v). Và bài toán được chứng minh. Bài toán 14(VMO 1992 bảng B). Cho hàm số f : R → R thỏa mãn f(x + 2xy) = f(x) + 2f(xy), ∀x, y ∈ R. Biết f(1991) = a, hãy tính f(1992) Giải Thay x = 0 ta được f(0) = 0. Thay y = −1 ta nhận được f(x) = −f(−x). Thay y = −1 2 ta được f(x) = 2f € x 2 Š . Xét x = 0 và số thực t bất kỳ, đặt y = t 2x ta nhận được: f(x + t) = f(x) + 2f € t 2 Š = f(x) + f(t) Vậy f là hàm Cauchy nên f(x) = kx, với k là hằng số nào đó. Từ f(1991) = a ⇒ k.1991 = a ⇒ k = a 1991 . Do đó f(1992) = 1992 1991 a Bài toán 15. Tìm tất cả các hàm số f(x) xác định trên (0, +∞), có đạo hàm tại x = 1 và thỏa mãn điều kiện f(xy) = √ xf(y) + √ yf(x), ∀x, y ∈ R+ Giải Xét các hàm số sau g(x) = f(x)√ x . Từ giả thiết của bài toán ta có: √ xy.g(xy) = √ xy.g(x) + √ xy.g(y) ⇔ g(xy) = g(x) + g(y), ∀x, y ∈ R+ Vậy g(x) = logax, x 0. GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

26. 2 PHƯƠNG TRÌNH HÀM CAUCHY Từ đó ta có kết quả hàm số f(x) = k. √ x.logax với k ∈ R. Lại từ (1) nếu ta đặt z = x + y thì y = z − x và quan hệ (1) trở thành f(z) = f(x).f(z − x), nếu với giả thiết f(x) = 0 ∀x ∈ R thì ta có thể viết lại như sau: f(z − x) = f(z) f(x) , và ta đề xuất được bài toán sau đây: Bài toán 18. Xác định các hàm số f(x) liên tục trên R thỏa mãn điều kiện: 8 : f(x − y) = f(x) f(y) , ∀x, y ∈ R f(x) = 0 ∀x ∈ R (2) Vì giả thiết là f(x) = 0 ∀x ∈ R nên chỉ có hàm số f(x) = ax (a 0) thỏa mãn yêu cầu bài toán. To be continued . GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

27. 3 PHƯƠNG PHÁP QUY NẠP 3 Phương pháp quy nạp Phương pháp này yêu cầu ta trước hết tính f(0), f(1) rồi dựa vào đó tính f(n) với n ∈ N. Sau đó tính f(n) với n ∈ Z. Tính tiếp f € 1 n Š , từ đó suy ra biểu thức của f(r) với r ∈ Q. Phương pháp này thường sử dụng khi cần tìm hàm số xác định trên N, Z, Q. Ví dụ 3.1. Tìm tất cả các hàm số f : Q → Q thỏa mãn điều kiện: f(1) = 2, f(xy) = f(x)f(y) − f(x + y) + 1, ∀x, y ∈ Q. (11) Giải Cho y = 1 và sử dụng giả thiết f(1) = 2 ta được f(x + 1) = f(x) + 1, ∀x ∈ Q. (12) Bằng phương pháp quy nạp ta chứng minh được f(x + m) = f(x) + m, ∀x ∈ Q, ∀m ∈ N. (13) Tiếp theo ta sẽ lần lượt chứng minh: a) f(n) = n + 1, ∀n ∈ N. Thật vậy trong (12) cho x = 0 ta tìm được f(0) = 1. Giả sử ta đã có f(k) = k + 1 thì f(k + 1) = f(k) + 1 = k + 1 + 1 = k + 2. b) Tiếp theo ta chứng minh f(m) = m+1, ∀m ∈ Z. Thật vậy, trong (12) cho x = −1 ta được f(−1) = 0. Trong (11) cho y = −1 thì ta có f(−x) = −f(x − 1) + 1, ∀x ∈ Q. Khi đó với m ∈ Z, m 0 thì đặt n = −m, khi đó n ∈ N nên sử dụng kết quả trên và phần (a) ta được f(m) = f(−n) = −f(n − 1) + 1 = −n + 1 = m + 1. c) Tiếp theo ta chứng minh f(x) = x + 1, ∀x ∈ Q. Trước tiên ta tính f 1 n , n ∈ N+ , bằng cách trong (11) cho x = n, y = 1 n ta có 2 = (n + 1)f 1 n − f n + 1 n + 1. Lại theo (13) thì f n + 1 n = f 1 n + n thay vào phương trình trên ta được f 1 n = n + 1 n = 1 n + 1. GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

30. 3 PHƯƠNG PHÁP QUY NẠP Từ đây lấy căn bậc hai ta được f(u + v) + f(u − v) = 2 (f(u) + f(v)) , ∀u ≥ v ≥ 0. Phương trình hàm này có nghiệm là f(x) = f(1)x2 , ∀x ≥ 0. Ngoài ra dễ dàng tính được f(1) = 0 hoặc f(1) = 1. Kết luận: Các hàm số thỏa mãn là f(x) ≡ 0, f(x) ≡ 1 2 và f(x) = x2 , ∀x ≥ 0. Nhận xét: Bài toán trên xuất phát từ một hằng đẳng thức quen thuộc là (x2 + y2 ) 2 = (x2 − y2 ) 2 + (2xy)2 . Và điểm mấu chốt của bài toán là tính chất f (x2 ) = (f(x))2 , để suy ra f(x) ≥ 0 khi x ≥ 0. Ví dụ 3.4. (China 1996) Cho hàm số f : R → R thỏa mãn điều kiện: f(x3 + y3 ) = (x + y)(f2 (x) − f(x)f(y) + f2 (y)), ∀x, y ∈ R. Chứng minh rằng f(1996x) = 1996f(x), ∀x ∈ R. Giải a) Tính f(0) và thiết lập cho f(x). Cho x = y = 0 ta được f(0) = 0. Cho y = 0 ta được f(x3 ) = xf2 (x). Nhận xét: f(x) và x luôn cùng dấu. Từ đây ta có f(x) = x 1 3 f2 (x 1 3 ). b) Thiết lập tập hợp tất cả các giá trị a mà f(ax) = af(x). Đặt S = {a 0 : f(ax) = af(x), ∀x ∈ R}. * Rõ ràng 1 ∈ S. * Ta chứng tỏ nếu a ∈ S thì a 1 3 ∈ S. Thật vậy axf2 (x) = af(x3 ) = f(ax3 ) = f (a 1 3 x)3 = a 1 3 x.f2 (a 1 3 x) ⇒ a 2 3 f2 (x) = f2 (a 1 3 x) ⇒ a 1 3 f(x) = f(a 1 3 x) * Nếu a, b ∈ S thì a + b ∈ S. Thật vậy f ((a + b)x) = f (a 1 3 x 1 3 )3 + (b 1 3 x 1 3 )3 = (a 1 3 + b 1 3 ) h f2 (a 1 3 x 1 3 ) − f(a 1 3 x 1 3 ).f(b 1 3 x 1 3 ) + f2 (b 1 3 x 1 3 ) i = (a 1 3 + b 1 3 ) h a 2 3 − a 1 3 b 1 3 + b 2 3 i x 1 3 f2 (x 1 3 ) = (a + b)f(x). Bằng quy nạp ta chứng tỏ mọi n ∈ N đều thuộc S. Và bài toán ra là trường hợp đặc biệt với n = 1996. GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

31. 3 PHƯƠNG PHÁP QUY NẠP Nhận xét: 1. Nếu chỉ đơn thuần chứng minh kết quả của bài toán thì có thể quy nạp trực tiếp. Bằng cách khảo sát như trên ta sẽ thấy hết được tất cả các giá trị của a 0 mà f(ax) = af(x). 2. Do yêu cầu “đặc biệt” của bài toán, nên tự nhiên ta sẽ nghĩ ngay là có thể chứng minh điều đó đúng với mọi số tự nhiên, và qua đó, sẽ nghĩ ngay đến hướng quy nạp. 3. Việc suy ra dấu của f(x) cùng dấu với x là quan trọng, nó giúp ta triệt tiêu bình phương mà không cần xét dấu, đây cũng là một điều đáng lưu ý trong rất nhiều bài tập khác. 4. Bài toán trên rất có thể xuất phát từ hằng đẳng thức x3 + y3 = (x + y) (x2 − xy + y2 ). Ví dụ 3.5. Tìm tất cả các hàm f : Z → Z thỏa mãn: f(x3 + y3 + z3 ) = f3 (x) + f3 (y) + f3 (z), ∀x, y, z ∈ Z Hint: 1. Tính f(0) và chứng minh f là hàm lẻ. 2. Chứng tỏ f(2) = 2f(1), f(3) = 3f(1). Chứng minh bằng quy nạp f(n) = nf(1), ∀n ∈ Z 3. Trong chứng minh chuyển từ n = k ≥ 0 sang n = k +1, ta sử dụng hằng đẳng thức sau: Nếu k chẵn thì k = 2t, ta có: (2t + 1)3 + 53 + 13 = (2t − 1)3 + (t + 4)3 + (4 − t)3 khi k = 2t và nếu k lẻ thì k = 2t − 1 khi đó n = 2t luôn được viết dưới dạng 2t = 2j (2i + 1), và đẳng thức trên chỉ cần nhân cho 23j Ví dụ 3.6. Tìm tất cả các hàm f : N → N thỏa mãn các điều kiện: f(1) 0 và f(m2 + n2 ) = f2 (m) + f2 (n), ∀m, n ∈ N Hint: 1. Tính f(0) ⇒ f(m2 + n2 ) = f(m2 ) + f(n2 ) 2. Chứng minh f(n) = n, ∀n ≤ 10. Với n 10 ta sử dụng các đẳng thức sau: (5k + 1)2 + 22 = (4k + 2)2 + (3k − 1)2 (5k + 2)2 + 12 = (4k + 1)2 + (3k + 2)2 (5k + 3)2 + 12 = (4k + 3)2 + (3k + 1)2 (5k + 4)2 + 22 = (4k + 2)2 + (3k + 4)2 (5k + 5)2 = (4k + 4)2 + (3k + 3)2 GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

32. 4 KHAI THÁC TÍNH CHẤT ĐƠN ÁNH, TOÀN ÁNH, SONG ÁNH, CHẴN LẺ CỦA HÀM SỐ 4 Khai thác tính chất đơn ánh, toàn ánh, song ánh, chẵn lẻ của hàm số Trước tiên ta nhắc lại các khái niệm cơ bản này. a) Nếu f : R → R là đơn ánh thì từ f(x) = f(y) ta suy ra được x = y. b) Nếu f : R → R là toàn ánh thì với mỗi y ∈ R, tồn tại x ∈ R để f(x) = y. c) Nếu f : R → R là song ánh thì ta có cả hai đặc trưng trên. Nếu một hàm số mà đơn ánh chúng ta rất hay dùng thủ thuật tác động f vào cả hai vế, nếu một hàm f toàn ánh ta hay dùng: Tồn tại một số b sao cho f(b) = 0, sau đó tìm b. Nếu quan hệ hàm là hàm bậc nhất của biến ở vế phải thì có thể nghĩ tới hai quan hệ này. Ví dụ 4.1. Tìm tất cả các hàm số f : Q → Q thỏa mãn f (f(x) + y) = x + f(y), ∀x, y ∈ Q. Giải Nhận xét, hàm đồng nhất 0 không thỏa mãn bài toán. Xét f(x) ≡ 0. a) f đơn ánh, thật vậy, nếu f(x1) = f(x2) thì f (f (x2) + y) = f (f (x2) + y) → x1 + f(y) = x2 + f(y) → x1 = x2. b) f toàn ánh, thật vậy, vì tồn tại y0 sao cho f(y0) = 0. Do đó vế phải của điều kiện là một hàm số bậc nhất của x nên có tập giá trị là Q. c) Tính f(0), cho x = y = 0 và sử dụng tính đơn ánh ta được f (f(0)) = f(0) → f(0) = 0. Từ đó thay y = 0 ta được f (f(x)) = x, ∀x ∈ Q. d) Thay x bởi f(x) và sử dụng kết quả trên(và điều này đúng cho với mọi x ∈ Q vì f là toán ánh) thì f(x + y) = f(x) + f(y), ∀x, y ∈ Q. Từ đây ta được f(x) = ax thay vào bài toán ta nhận f(x) ≡ x hoặc f(x) ≡ −x trên Q. Nhận xét: Nếu yêu cầu bài toán trên tập R thì cần thêm tính chất đơn điệu hoặc liên tục. Cụ thể, các bạn có thể giải lại bài toán sau (THTT, 2010): Tìm tất cả các hàm số liên tục f : R → R thỏa mãn điều kiện f (x + f(y)) = 2y + f(x), ∀x, y ∈ R. Ví dụ 4.2. Tìm tất cả các hàm số f : R → R thỏa mãn f (xf(y) + x) = xy + f(x), ∀x, y ∈ R. GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

33. 4 KHAI THÁC TÍNH CHẤT ĐƠN ÁNH, TOÀN ÁNH, SONG ÁNH, CHẴN LẺ CỦA HÀM SỐ Giải Thay x = 1 vào điều kiện hàm ta được f (f(y) + 1) = y + f(1), ∀y ∈ R. Từ đây suy ra f là một song ánh. Lấy x = 1, y = 0 ta được f (f(0) + 1) = f(1) → f(0) = 0 do fđơn ánh. Bây giờ với x = 0, đặt y = − f(x) x thay vào điều kiện hàm ta được f (xf(y) + x = 0 = f(0)) → xf(y) = x do fđơn ánh, hay f(y) = −1, tức là f ‚ − f(x) x Œ = f(y) = −1 = f(b), với b là một số thực nào đó(do f là một toàn ánh). Vậy f(x) = −bx, ∀x = 0. Kết hợp với f(0) = 0 thì viết gộp thành f(x) = −bx, ∀x ∈ R. Thay vào điều kiện hàm số ta có được hai hàm thỏa mãn là f(x) ≡ x và f(x) ≡ −x. Nhận xét: Bài toán này có thể giải bằng cách thế biến như sau mà không cần dùng đến tính song ánh của hàm số. Thay x = 1 ta được f (f(y) + 1) = y + f(1), ∀y ∈ R. Ví dụ 4.3. (Đề nghị IMO 1988) Xác định hàm số f : N → N thỏa mãn điều kiện sau: f(f(n) + f(m)) = m + n, ∀m, n ∈ N. (14) Giải a) Trước tiên ta kiểm tra f đơn ánh. Thật vậy giả sử f(n) = f(m), khi đó f (2f(n)) = f (f(n) + f(n)) = 2n, và f (2f(n)) = f (f(m) + f(m)) = 2m. Do đó m = n, nên f đơn ánh. b) Ta tính f (f(n)) theo các bước sau: cho m = n = 0 trong (14) thì ta được f (2f(0)) = 0, lại cho m = 2f(0) vào trong (14) thì ta được f (f(n)) = n + 2f(0). GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

34. 4 KHAI THÁC TÍNH CHẤT ĐƠN ÁNH, TOÀN ÁNH, SONG ÁNH, CHẴN LẺ CỦA HÀM SỐ c) Tác động f vào cả hai vế của (14) và sử dụng kết quả trên, ta được f (f (f(n) + f(m))) = f(n) + f(m) + 2f(0). Ngoài ra theo quan hệ đề bài thì f (f (f(n) + f(m))) = f(n + m). Từ đây ta có f(n + m) = f(n) + f(m) + 2f(0). Cho m = n = 0 thì f(0) = 0, do đó quan hệ trên trở thành hàm cộng tính. Vậy f(n) = an. Thay vào quan hệ bài toán ta được f(n) = n, ∀n ∈ N. – Nhận xét: Quan hệ đơn ánh của bài toán này không cần thiết trong lời giải. Và bài toán này có thể chứng minh bằng quy nạp trên N. Cách 2. Nếu xét trên Z+ thì ta có thể chứng minh bằng quy nạp f(x) = x, ∀x ∈ N. Tức là, dùng phương pháp, ta chứng minh không còn tồn tại hàm số nào khác. Trước tiên ta tính f(1). Giả sử f(1) = t 1, đặt s = f(t − 1) 0. Nhận thấy rằng nếu f(m) = n thì f(2n) = f (f(m) + f(m)) = 2m. Như vậy f(2t) = 2, f(2s) = 2t − 2. Nhưng khi đó thì 2s + 2t = f (f(2s) + f(2t)) = f(2t) = 2 → t 1, điều này vô lý. Vậy f(1) = 1. Giả sử ta có f(n) = n thì f(n + 1) = f (f(n) + f(1)) = n + 1. Vậy f(n) = n, ∀n ∈ Z+ . Ví dụ 4.4. (Balkan 2000) Tìm tất cả các hàm số f : R → R thỏa mãn điều kiện: f (xf(x) + f(y)) = (f(x))2 + y, ∀x, y ∈ R. (15) Giải a) Ta tính f (f(y)) bằng cách cho x = 0 vào (15) ta được f (f(y)) = (f(0))2 + y, ∀y ∈ R. b) Chứng tỏ f đơn ánh. Thật vậy nếu f(y1) = f(y2) thì f (f(y1)) = f (f(y2)). Từ đây theo phần (a) thì f2 (0) + y1 = (f(0))2 + y2 ⇒ y1 = y2. c) Chứng tỏ f toàn ánh vì vế phải của (15) là một hàm bậc nhất của y nên có tập giá trị bằng R. Kết hợp hai điều trên ta thu được f là một song ánh từ R vào R. GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

35. 4 KHAI THÁC TÍNH CHẤT ĐƠN ÁNH, TOÀN ÁNH, SONG ÁNH, CHẴN LẺ CỦA HÀM SỐ d) Tính f(0). Dựa vào tính toàn ánh thì phải tồn tại a ∈ R để f(a) = 0. Thay x = y = a vào (15) ta được f (af(a) + f(a)) = (f(a))2 + a ⇒ f(0) = a. Do f là một song ánh nên a = 0, tức f(0) = 0. Từ đây theo (a) thì f (f(x)) = x, ∀x ∈ R. Trong (15) cho y = 0 ta được f (xf(x)) = (f(x))2 , ∀x ∈ R. (16) Trong quan hệ trên, thay x bởi f(x) ta được(thay được đúng với mọi x ∈ R vì f là song ánh) f (f(x).f (f(x))) = [f (f(x))]2 , ∀x ∈ R ⇔ f (f(x) · x) = x2 , ∀x ∈ R ⇔ (f(x))2 = x2 , ∀x ∈ R. Từ đây suy ra với mỗi x ∈ R thì hoặc là f(x) = x hoặc là f(x) = −x. Chúng ta chứng tỏ là phải có sự đồng nhất f(x) = x, ∀x ∈ R hoặc là f(x) = −x, ∀x ∈ R chứ không thể xảy ra sự đan xen giữa hai giá trị. Thật vậy, giả sử tồn tại a = 0, n = 0 sao cho f(a) = −a, f(b) = b thì khi đó trong quan hệ (15) thay x = a, y = b ta được f € −a2 + b Š = a2 + b. Nhưng vì giá trị của f(−a2 + b) chỉ có thể là −a2 + b hoặc là a2 − b. Nhưng nhận thấy a2 + b không thể bằng với một giá trị nào trong hai giá trị trên. Vậy điều giả sử là sai. Kiểm tra lại thấy hai hàm số f(x) = x, ∀x ∈ R hoặc là f(x) = −x, ∀x ∈ R thỏa mãn yêu cầu bài toán. Ví dụ 4.5. (IMO 1992) Tìm tất cả các hàm số f : R → R thỏa mãn điều kiện f € x2 + f(y) Š = (f(x))2 + y, ∀x, y ∈ R. (17) Giải a) f đơn ánh, thật vậy nếu f (y1) = f (y2) thì f € x2 + f (y1) Š = f € x2 + f (y2) Š → (f(x))2 + y1 = (f(x))2 + y2 → y1 = y2. b) f toàn ánh, vì vế trái làm hàm bậc nhất theo y nên f có tập giá trị là toàn bộ R. Kết hợp hai điều trên suy ra f là một song ánh. c) Tính f(0). Do f song ánh nên tồn tại duy nhất a ∈ R sao cho f(a) = 0. Thay x = 0 ta được f (f(y)) = (f(0))2 + y. Thay x = y = a vào (17) và sử dụng kết quả trên, ta được f € a2 Š = a →f(a) = f € f € a2 ŠŠ →0 = (f(0))2 + a2 →f(0) = a = 0. GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

36. 4 KHAI THÁC TÍNH CHẤT ĐƠN ÁNH, TOÀN ÁNH, SONG ÁNH, CHẴN LẺ CỦA HÀM SỐ Từ đây ta thu được quan hệ quen thuộc f (f(x)) = x, ∀x ∈ R và f € x2 Š = (f(x))2 (thay y = 0). Từ đây thì nếu x ≥ 0 thì f(x) ≥ 0, ngoài ra f(x) = 0 khi và chỉ khi x = 0. Bây giờ lấy x ≥ 0, y ∈ R thì f(x + y) = f €√ x Š2 + f (f(y)) = € f €√ x ŠŠ2 + f(y) = f €√ x Š2 + f(y), hay f(x + y) = f(x) + f(y), ∀x ≥ 0, y ∈ R. Thay y = −x ta được f(−x) = −f(x) hay f là hàm lẻ. Do đó nếu x 0 thì f(x + y) = f (−(−x − y)) = −f(−x − y) = −f(−x) − f(−y) = f(x) + f(y), ∀y ∈ R, ∀x 0. Kết hợp hai điều trên ta thu được quan hệ cộng tính của hàm f f(x + y) = f(x) + f(y), ∀x, y ∈ R. Ngoài ra sử dụng tính chất f(x) = 0 khi và chỉ khi x = 0 ta còn có thêm f đơn điệu tăng. Thật vậy, với x y thì x − y 0 nên f(x − y) 0, do đó f(x) = f ((x − y) + y) = f(x − y) + f(y) f(y). Hàm f cộng tính và đơn điệu nên có dạng f(x) = ax, thay vào ta được a = 1. Vậy f(x) = x, ∀x ∈ R thỏa mãn bài toán. Ví dụ 4.6. Tìm tất cả các hàm số f : R → R thỏa mãn f (x + f(y)) = x + f(y) + xf(y), ∀x, y ∈ R. Giải Ta có thể viết lại quan hệ hàm dưới dạng f (x + f(y)) = (f(y) + 1) x + f(y), ∀x, y ∈ R. (18) a) Nếu f(x) ≡ −1, dễ dàng kiểm tra hàm này thỏa mãn. b) Xét f(x) không đồng nhất −1. Khi đó phải tồn tại y0 ∈ R để f (y0) = −1. Khi đó vế phải của (18) là hàm bậc nhất của x nên có tập giá trị là R. Điều này chứng tỏ f là toàn ánh. Cho x = 0 ta thu thêm được một quan hệ nữa là f (f(x)) = f(x), ∀x ∈ R. Khi đó với mọi x ∈ R, do f toàn ánh nên sẽ tồn tại y(phụ thuộc vào x) sao cho x = f(y), khi đó f(x) = f (f(y)) = f(y) = x. Tuy nhiên, thay hàm này vào (18) thì không thỏa mãn. GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

38. 4 KHAI THÁC TÍNH CHẤT ĐƠN ÁNH, TOÀN ÁNH, SONG ÁNH, CHẴN LẺ CỦA HÀM SỐ Bây giờ ta giải phương trình hàm f € x2 + y + f(y) Š = (f(x))2 + 2y, ∀x, y ∈ R. (22) Thay y = − (f(x))2 2 vào (22) ta được f x2 − (f(x))2 2 ! + f − (f(x))2 2 ! = 0, ∀x ∈ R. Vì tính chất của f là f(x) = 0 khi và chỉ khi x = 0 nên f − (f(x))2 2 ! = −x2 + (f(x))2 2 , ∀x ∈ R. Lại trong (22) và sử dụng kết quả trên ta được f € x2 − y2 Š = (f(x))2 − (f(y))2 = f(x2 ) − f(y2 ), ∀x, y ∈ R. Từ đẳng thức này cho x = 0 thì f (−y2 ) = −f(y2 ) tức f là hàm lẻ. Nên quan hệ trên có thể viết lại dưới dạng f(x + y) = f(x) + f(y), ∀x, y ∈ R. Lại sử dụng (f(x))2 = f (x2 ) thì (f(x + y))2 = f ((x + y)2 ), khai triển và sử dụng tính cộng tính ta được f(xy) = f(x)f(y), ∀x, y ∈ R. Hàm f vừa cộng tính, vừa nhân tính nên f(x) ≡ x. Thử lại thấy hàm số này thỏa mãn đề bài. Nhận xét: Một phần của bài toán trên xuất hiện đầu tiên trên tạp chí AMM, được đề xuất bởi Wu Wei Chao, và được chọn là một bài toán chọn đội tuyển Bungari năm 2003 và chọn đội tuyển Iran 2007, trong đó chỉ giải quyết cho trường hợp a = 2. Ví dụ 4.8. (Đề nghị IMO 2002) Tìm tất cả các hàm số f : R → R thỏa mãn f (f(x) + y) = 2x + f (f(y) − x) , ∀x, y ∈ R. Giải a) f toàn ánh, thật vậy thay y = −f(x) ta được f (f (−f(x)) − x) = f(0) − 2x, ∀x ∈ R. Do vế phải là hàm bậc nhất của x nên có tập giá trị là R. b) Vì f toàn ánh nên tồn tại a sao cho f(a) = 0. Thay x = a vào đề bài thì f(y) − a = f (f(y) − a) + a. Vì f toàn ánh nên quan hệ trên có thể viết lại f(x) = x − a với a là hằng số. GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

39. 4 KHAI THÁC TÍNH CHẤT ĐƠN ÁNH, TOÀN ÁNH, SONG ÁNH, CHẴN LẺ CỦA HÀM SỐ Thử lại thấy hàm số này thỏa mãn. Ví dụ 4.9. (THTT T8/360). Tìm tất cả các hàm số f : R+ → R+ thỏa mãn f(x).f(y) = f (x + yf(x)) , ∀x, y ∈ R+ . (23) Giải Giả sử f là hàm số thỏa mãn bài toán. a) Nếu f(x) ∈ (0, 1), ∀x ∈ R+ thì khi thay y = x 1 − f(x) vào (23) ta được f(x)f ‚ x 1 − f(x) Œ = f ‚ x 1 − f(x) Œ , ∀x ∈ R+ , suy ra f(x) = 1, trái với giả thiết f(x) ∈ (0, 1). Vậy giá trị của hàm số f luôn lớn hơn hoặc bằng 1. b) Nếu tồn tại giá trị a ∈ R+ sao cho f(a) = 1, thì khi đó thay x = a ta được f(y + a) = f(y), ∀y ∈ R+ . Ngoài ra, ứng với mỗi x ∈ R+ cố định và h ∈ R+ cho trước, luôn tồn tại y ∈ R+ để yf(x) = h. Do đó f(x + h) = f (x + yf(x)) = f(x)f(y) ≥ f(x). Kết hợp hai điều trên bắt buộc phải có f(x) ≡ 1. Kiểm tra lại thấy hàm số này thỏa mãn. c) Nếu f(x) 1, ∀x ∈ R+ thì f đơn ánh. Thật vậy, khi đó f(x + h) = f (x + yf(x)) = f(x)f(y) f(x), ∀x, h ∈ R+ . Chứng tỏ f là hàm đồng biến ngặt trên R+ , do đó nó là một đơn ánh trên R+ . Đổi vai trò của x và y trong (23) ta có f (y + xf(x)) = f (x + yf(x)) , ∀x, y ∈ R+ . Vì f đơn ánh nên y + xf(y) = x + yf(x), ∀x, y ∈ R+ . Từ đây ta có f(x) x − 1 x = f(y) y − 1 y , ∀x, y ∈ R+ , hay f(x) x − 1 x = a, ∀x ∈ R+ → f(x) = ax + 1, a 0. Thử lại thấy hai hàm số f(x) ≡ 1 hoặc f(x) = ax + 1, a 0, ∀x ∈ R+ thỏa mãn bài toán. Ví dụ 4.10. (USA 2002) Tìm tất cả các hàm số f : R → R thỏa mãn f € x2 − y2 Š = xf(x) − yf(y), ∀x, y ∈ R. Giải GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

40. 4 KHAI THÁC TÍNH CHẤT ĐƠN ÁNH, TOÀN ÁNH, SONG ÁNH, CHẴN LẺ CỦA HÀM SỐ a) f(0) = 0 (thay x = y = 0). b) f là hàm lẻ, thật vậy −xf(−x)−yf(y) = f € (−x)2 − y2 Š = f(x2 −y2 ) = xf(x)−yf(y), ∀x, y ∈ R → f(x) = −f(−x), ∀x = 0. Từ đây ta chỉ tính toán với x, y ≥ 0. c) f(x) = f(x − y) + f(y) (1). Cho x = 0 ta được f (x2 ) = xf(x), thay vào quan hệ hàm ta được f € x2 Š = f € x2 − y2 Š + f € y2 Š → f(u) = f(u − v) + f(v), ∀u, v ≥ 0. d) f(2t) = 2f(t), chỉ cần thay x = 2t, y = t vào (1). e) Tính f(2t + 1) theo hai cách, trước tiên với x = t + 1, y = 1 thế vào (1) ta được f(t + 1) = f(t) + f(1). Thay x = t + 1, y = t vào điều kiện ban đầu cùng với sử dụng kết quả trên, ta được f(2t + 1) = (t + 1)f (t + 1) − tf(t) = f(t) + (t + 1)f(1). Ngoài ra, thay 2t + 1, y = 1 vào trong (1) ta được f(2t + 1) = f(2t) + f(1) = 2f(t) + f(1). Kết hợp hai kết quả trên ta được 2f(t) + f(1) = f(t) + (t + 1)f(1) → f(t) = tf(1), ∀t ≥ 0. Vậy f(x) = ax, ∀x ∈ R, a là hằng số. Kiểm tra lại thấy hàm số này thỏa mãn. Nhận xét: 1. Quan hệ (1) là quan hệ cộng tính. Tuy nhiên nếu ta dùng tính cộng tính ở đây thì chỉ thu được kết quả trên Q. Và giả thiết của bài toán không thể khai thác thêm được tính chất liên tục hoặc đơn điệu nên không thể có được kết quả hàm f(x) = ax. Cách tính f(2t + 1) theo hai cách trên là một ý tưởng hay, mang tư tưởng của cách tính sai phân. 2. Nếu bài toán có thêm giả thiết (f(x))2 = f (x2 ) thì bằng các khai triển (f(x + 1))2 = (f(x + 1))2 theo tính chất cộng tính, ta thu được quan hệ nhân tính, từ đó bài toán dễ dàng giải hơn. Ví dụ 4.11. Tìm tất cả các hàm số f : R → R thỏa mãn điều kiện: f ((1 + x)f(y)) = yf (f(x) + 1) , ∀x, y ∈ R. Giải Rõ ràng nhìn từ quan hệ hàm ta thấy nếu hàm số f là đơn ánh thì bài toán trở nên rất dễ dàng. Thật vậy nếu hàm f đơn ánh thì thay y = 1 ta được f ((1 + x)f(1)) = f (f(x) + 1) , ∀x ∈ R. GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

41. 4 KHAI THÁC TÍNH CHẤT ĐƠN ÁNH, TOÀN ÁNH, SONG ÁNH, CHẴN LẺ CỦA HÀM SỐ Từ đây do f đơn ánh nên (1 + x)f(1) = f(x) + 1, hay f(x) có dạng hàm số bậc nhất f(x) = ax + b. Thay lại vào quan hệ hàm ta được a = 1, b = 0. Vậy trong trường hợp này có hàm số f(x) = x, ∀x ∈ R thỏa mãn bài toán. Vấn đề còn lại là nếu hàm f không đơn ánh. Tức là tồn tại y1 = y2 mà f (y1) = f (y2). Khi đó ta có y1f (f(x) + 1) = f ((1 + x)f (y1)) f ((1 + x)f (y2)) = y2f (f(x) + 1) , ∀x, ∈ R. Từ điều trên thì phải có f (f(x) + 1) = 0, ∀x ∈ R. Thay vào quan hệ hàm ta phải có f ((1 + x)f(y)) = 0, ∀x, y ∈ R. Nếu tồn tại y0 sao cho f(y0) = 0 thì ta có f ((1 + x)f (y0)) = 0, ∀x ∈ R hay f(x) ≡ 0(mâu thuẫn). Vậy chứng tỏ không tồn tại y0 để f(y0) = 0, tức f(y) ≡ 0. Từ đây ta có hàm đồng nhất f(x) ≡ 0 thỏa mãn bài toán. Nhận xét: Quan hệ đơn ánh trong bài toán này chính là điểm mấu chốt của lời giải. Ví dụ 4.12. Xác định tất cả các hàm số f : N → N, đồng thời thỏa mãn hai điều kiện: f(2) = 2 và f(mn) = f(m)f(n), ∀m, n ∈ N Ví dụ 4.13. Tìm tất cả các hàm số liên tục f : R → R thỏa mãn điều kiện: f(xf(y)) = yf(x), ∀x, y ∈ R Hint: 1. Nhận thấy f(x) ≡ 0 thỏa mãn. Xét f(x) = 0. 2. Kiểm tra f đơn ánh, cùng với f liên tục, f(1) f(0) nên f tăng ngặt. 3. Tác động f vào hai vế, so ánh f(xf(y)) và xf(y). Đáp số: f(x) = x, ∀x ∈ R. Nhận xét: Bài toán này cũng có thể dùng phép thế thích hợp để đưa về hàm nhân tính Ví dụ 4.14. Tìm tất cả các hàm số f : Z+ → Z+ thỏa mãn: f (f(n) + m) = n + f(m + 2003), ∀m, n ∈ Z+ . Giải a) Trước tiên ta chứng minh f đơn ánh. Thật vậy nếu f (n1) = f (n2) thì f (f(n1) + m) = f (f(n2) + m) →n1 + f(m + 2003) = n2 + f(m + 2003) → n1 = n2 b) Thay m = f(1) ta có f (f(n) + f(1)) = n + f (f(1) + 2003) = n + 1 + f(2003 + 2003) = f (f(n + 1) + 2003) Vì f đơn ánh nên f(n)+f(1) = f(n+1)+2003 hay f(n+1) = f(n)+f(1)−2003. Điều này dẫn đến f(n + 1) − f(n) = f(1) − 2003, tức f(n) có dạng như một cấp số cộng, với công sai là f(1) − 2003, số hạng đầu tiên là f(1). Vậy f(n) có dạng f(n) = f(1) + (n − 1) (f(1) − 2003), tức f(n) = an + b. Thay vào quan hệ hàm ta được f(n) = n + 2003, ∀n ∈ Z+ . GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

42. 5 KHAI THÁC TÍNH ĐƠN ĐIỆU CỦA HÀM SỐ 5 Khai thác tính đơn điệu của hàm số Trong mục này, ta xét một số bài toán giải phương trình hàm có sử dụng đến tính đơn điệu của hàm số. Một số điều cần lưu ý: a) Nếu f cộng tính và đơn điệu trên R (hoặc R+ ) thì f(x) = kx. b) Nếu f đơn điệu thực sự thì f là đơn ánh. c) Trong một vài trường hợp, nếu ta dự đoán được công thức của hàm số chẳng hạn f(x) = g(x) thì có thể xét f(x) g(x) và f(x) g(x), sau đó sử dụng tính đơn điệu của hàm f để dẫn tới điều vô lý. d) Nếu hàm f đơn điệu và ta đã có công thức của f trên tập số hữu tỉ Q thì dùng kỹ thuật chọn hai dãy hữu tỉ đơn điệu ngược nhau, rồi sau đó chuyển qua giới hạn. Ví dụ 5.1. Tìm tất cả các hàm đơn điệu f : R → R thỏa mãn f(x + f(y)) = f(x) + y, ∀x, y ∈ R. Giải a) Ta chứng minh f đơn ánh. Thật vậy giả sử f(x1) = f(x2), khi đó với mọi x ∈ R ta có f(x + f(x1)) = f(x + f(x2)) ⇒ f(x) + x1 = f(x) + x2 ⇒ x1 = x2. b) Lại thay x = 0 thì f(f(y)) = f(0) + y hay f(f(x)) = x + f(0)∀x ∈ R. c) Bây giờ thay x = f(x) vào quan hệ hàm thì f (f(x) + f(y)) = f(f(x)) + y = x + y + f(0) = f(0 + f(x + y)). Do f đơn ánh nên f(x+y) = f(x)+f(y), ∀x, y ∈ R. Vì f đơn điệu và cộng tính trên R nên f(x) = kx. Thay vào quan hệ hàm ta tìm được k = ±1. Vậy f(x) = x hay f(x) = −x là những hàm số cần tìm. Ví dụ 5.2. Tìm tất cả các hàm tăng nghiêm ngặt f : R → R thỏa mãn f(f(x) + y) = f(x + y) + 1, ∀x, y ∈ R. Giải a) Tính f (f(x)). Cho y = 0 ta được f(f(x)) = f(x) + 1. GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

43. 5 KHAI THÁC TÍNH ĐƠN ĐIỆU CỦA HÀM SỐ b) Sử dụng tính đơn điệu của hàm số. Thay x bởi f(x) và sử dụng kết quả trên ta có f(f(f(x)) + y) = f(f(x) + y) + 1 ⇒ f(f(x) + 1 + y) = f(x + y) + 1 + 1. (24) Thay y bởi f(y) ta được f(f(x) + f(y)) = f(x + f(y)) + 1 = f(x + y) + 1 + 1. (25) Từ (24) và (25) ta được f(f(x) + y + 1) = f(f(x) + f(y)). Vì f là hàm đơn điệu nên f(x) + y + 1 = f(x) + f(y) ⇒ f(x) = x + 1, ∀x ∈ R. Thử lại thấy hàm số f(x) = x + 1, ∀x ∈ R thỏa mãn yêu cầu đề bài. Ví dụ 5.3. (Hy lạp 1997) Giả sử f : (0, ∞) → R thỏa mãn ba điều kiện: (a) f tăng nghiêm ngặt. (b) f(x) −1 x với mọi x 0 và (c) f(x)f € f(x) + 1 x Š = 1 với mọi x 0. Tính f(1). Giải Đặt t = f(1). Thế x = 1 vào (c), ta được tf(t + 1) = 1. Do đó t = 0 và f(t + 1) = 1 t . Lại đặt x = t + 1 vào trong (c) ta được f(t + 1)f f(t + 1) + 1 t + 1 = 1. Khi đó f 1 t + 1 t + 1 = t = f(1). Do f là hàm tăng nghiệm ngặt nên 1 t + 1 t + 1 = 1. Giải ra ta được t = 1± √ 5 2 . Nếu t = 1+ √ 5 2 0, thì 1 t = f(1) f(1 + t) = 1 t 1 mâu thuẫn. Do đó f(1) = t = 1− √ 5 2 . Chú ý là hàm số f(x) = 1 − √ 5 2x là một hàm thỏa mãn yêu cầu bài toán. GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

44. 5 KHAI THÁC TÍNH ĐƠN ĐIỆU CỦA HÀM SỐ Ví dụ 5.4. Tìm tất cả các hàm số f : [1; +∞) → [1; +∞) thỏa mãn f (xf(y)) = yf(x), ∀x ∈ [1; +∞). Giải a) f là hàm đơn ánh. Thật vậy nếu f(y1) = f(y2) thì f (xf(y1)) = f (xf(y2) ⇔ y1f(2x) = y2f(2x), ∀x ∈ [1; +∞) ⇔ y1 = y2. (điều trên đúng vì miền giá trị của hàm số nằm trong [1; +∞), tức là khác 0). b) Tính f(1). Cho x = y = 1 thì f (f(1)) = f(1), do f đơn ánh nên f(1) = 1. c) Cho x = 1 thì f (f(y)) = y. d) Với y 1 thì f(y) 1(do f đơn ánh). Với x y ≥ 1 thì f(x) = f ‚ x y .y Œ = f ‚ x y .f(f(y)) Œ = f(y).f ‚ x y Œ f(y). Suy ra f đồng biến trên [1; +∞). e) Ta chứng minh f(x) = x, ∀x ∈ [1; +∞). Thật vậy, giả sử có x0 ∈ [1; +∞) sao cho f(x0) = 0. Nếu f(x0) x0 thì f (f(x0)) f(x0) ⇒ x0 f(x0) vô lý. Tương tự cho trường hợp ngược lại. Vậy f(x) = x, ∀x ∈ [1; +∞) thỏa mãn yêu cầu bài toán. Ví dụ 5.5. (Iran 1997) Cho f : R → R là hàm giảm thỏa mãn f(x + y) + f(f(x) + f(y)) = f[f(x + f(y)) + f(y + f(x))], ∀x ∈ R. Chứng minh rằng f (f(x)) = x, ∀x ∈ R. Giải a) Làm xuất hiện f (f(x)). Cho y = x ta được f(2x) + f(2f(x)) = f (2f(x + f(x))) . (26) Thay x = f(x) trong vào trong (26) ta được f(2f(x)) + f(2f(f(x))) = f (2f(f(x) + f(f(x)))) . (27) Lấy (27) trừ cho (26) ta được f (2f (f(x))) − f(2x) = f (2f (f(x) + f (f(x)))) − f (2f (x + f(x))) . (28) GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

45. 5 KHAI THÁC TÍNH ĐƠN ĐIỆU CỦA HÀM SỐ b) Sử dụng tính chất hàm f là hàm giảm. Giả sử tồn tại x0 sao cho f (f(x0)) x0, khi đó 2f (f(x0)) 2×0. Do f là hàm giảm nên f (2f (f(x0))) f(2×0). Do đó vế trái của (28) nhỏ hơn 0. Vậy f (2f (f(x0) + f (f(x0)))) − f (2f (x0 + f(x0))) 0 ⇒ f (2f (f(x0) + f (f(x0)))) f (2f (x0 + f(x0))) . Lại do f là hàm giảm nên 2f (f(x0) + f (f(x0))) 2f (x0 + f(x0)) ⇒ f(x0) + f (f(x0)) x0 + f(x0) ⇒ f (f(x0)) x0. Điều này dẫn đến mâu thuẫn. Nếu tồn tại x0 sao cho f (f(x0)) x0 thì lập luận tương tự như trên ta cũng dẫn đến điều vô lý. Vậy f (f(x)) = x, ∀x ∈ R. Ví dụ 5.6. (Italy 2000) a) Tìm tất cả các hàm đơn điệu ngặt f : R → R thỏa mãn f (x + f(y)) = f(x) + y, ∀x, y ∈ R. b) Chứng minh rằng với mọi số nguyên n 1, không tồn tại hàm đơn điệu ngặt f : R → R sao cho f (x + f(y)) = f(x) + yn , ∀x, y ∈ R. Giải Hàm đơn điệu ngặt thì đơn ánh. Ngoài ra dễ thấy f là một song ánh. a) Thế x = y = 0 ta được f (f(0)) = f(0). Do f đơn ánh nên f(0) = 0. Từ đó ta được quan hệ f (f(x)) = x, ∀x ∈ R. Khi đó với mọi z ∈ R, thay y = f(z) vào quan hệ hàm ta được f(x + z) = f(x) + f(z), ∀x, z ∈ R. Từ tính chất cộng tính của hàm f và tính đơn điệu ngặt của f, suy ra f có dạng f(x) = ax. Thay vào hàm ban đầu ta được f(x) ≡ x hoặc f(x) ≡ −x là hai hàm thỏa mãn yêu cầu bài toán. Cách khác: Ta có thể kiểm tra trực tiếp hai hàm số này như sau. Xét trường hợp f là hàm tăng, giả sử tồn tại x0 ∈ R sao cho f(x0) x0, thì do f là hàm tăng nên f (f(x0)) f(x0) → x0 f(x0), vô lý, tương tự cho trường hợp f(x0) x0. Vậy f(x) ≡ x. Tương tự cho hàm giảm. GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

48. 6 KHAI THÁC TÍNH CHẤT ĐIỂM BẤT ĐỘNG CỦA HÀM SỐ 6 Khai thác tính chất điểm bất động của hàm số Cho hàm số f : X → R. Điểm a ∈ X gọi là điểm cố định(điểm bất động, điểm kép) của hàm số f nếu f(a) = a. Việc nghiên cứu các điểm bất động của một hàm số cũng cho ta một số thông tin về hàm số đó. Điểm bất động a của hàm số f chính là chu trình bậc 1 của điểm a qua ánh xạ f Ví dụ 6.1. (IMO 1983) Tìm các hàm số f : R+ → R+ thỏa mãn hai điều kiện: limx→∞ f(x) = 0 và f(xf(y)) = yf(x), ∀x, y ∈ R+ Giải a) Tính f(1). Cho x = y = 1, ta được f (f(1)) = f(1). Lại cho y = f(1) ta được f (xf (f(1))) = f(1)f(x) ⇒ f (xf(1)) = f(1)f(x). Mặt khác f (xf(1)) = f(x) nên ta được f(x) = f(x)f(1) ⇒ f(1) = 1(do f(x) 0). b) Điểm cố định của hàm số Cho x = y vào quan hệ hàm ta được f (xf(x)) = xf(x), ∀x ∈ R+ . Suy ra xf(x) là điểm bất động của hàm số f. c) Một số đặc điểm của tập điểm cố định. Nếu x và y là hai điểm cố định của hàm số, thì f(xy) = f (xf(y)) = yf(x) = xy. Chứng tỏ xy cũng là điểm bất động của hàm số. Như vậy tập các điểm bất động đóng với phép nhân. Hơn nữa nếu x là điểm bất động thì 1 = f(1) = f 1 x f(x) = xf 1 x ⇒ f 1 x = 1 x . Nghĩa là 1 x cũng là điểm bất động của hàm số. Như vậy tập các điểm bất động đóng với phép nghịch đảo. Như vậy ngoài 1 là điểm bất động ra, nếu có điểm bất động nào khác thì hoặc điểm bất động này lớn hơn 1, hoặc nghịch đảo của nó lớn hơn 1. Do đó lũy thừa nhiều lần của điểm này lớn hơn 1 cũng sẽ là điểm bất động. Điều này trái với điều kiện thứ 2 trong quan hệ hàm. d) Vậy 1 là điểm bất động duy nhất của hàm số, do xf(x) là điểm bất động của hàm số với mọi x 0 nên từ tính duy nhất ta suy ra f(x) = 1 x . Dễ thấy hàm số này thỏa mãn yêu cầu bài toán. GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

49. 6 KHAI THÁC TÍNH CHẤT ĐIỂM BẤT ĐỘNG CỦA HÀM SỐ Ví dụ 6.2. (IMO 1994) Giả sử S là tập hợp các số thực lớn hơn −1. Tìm tất cả các hàm số f : S → S sao cho các điều kiện sau được thỏa mãn a) f[x + f(y)) + xf(y)] = y + f(x) + yf(x) ∀x, y ∈ S b) f(x) x là hàm thực sự tăng với −1 x 0 và với x 0 . Giải a) Tìm điểm bất động. Từ điều kiện (b) ta nhận thấy phương trình điểm bất động f(x) = x có nhiều nhất là 3 nghiệm(nếu có): một nghiệm nằm trong khoảng (−1; 0), một nghiệm bằng 0, một nghiệm nằm trong khoảng (0; +∞). b) Nghiên cứu điểm bất động của hàm số. Giả sử u ∈ (−1; 0) là một điểm bất động của f. Trong điều kiện (a) cho x = y = u ta được f(2u + u2 ) = 2u + u2 . Hơn nữa 2u + u2 ∈ (−1; 0) và 2u + u2 là một điểm bất động nữa của hàm số trong khoảng (−1; 0). Theo nhận xét trên thì phải có 2u + u2 = u ⇒ u = −u2 ∈ (−1; 0). Hoàn toàn tương tự, không có điểm bất động nào nằm trong khoảng (0; +∞). Như thế 0 là điểm bất động duy nhất của hàm số(nếu có). c) Kết luận hàm Cho x = y vào (a) ta được f (x + f(x) + xf(x)) = x + f(x) + xf(x), ∀x ∈ S. Như vậy với mọi x ∈ S thì x + (1 + x)f(x) là điểm bất động của hàm số. Theo nhận xét trên thì x + (1 + x)f(x) = 0, ∀x ∈ S ⇒ f(x) = − x 1 + x , ∀x ∈ S. Thử lại thấy hàm này thỏa mãn yêu cầu bài toán. Ví dụ 6.3. (IMO 1996) Tìm tất cả các hàm số f : N → N sao cho: f(m + f(n)) = f(f(m)) + f(n), ∀m, n ∈ N. Giải a) Tính f(0). Cho m = n = 0 thì ta có f (f(0)) = f (f(0)) + f(0) ⇒ f(0) = 0. Từ đây lại cho n = 0 thì f (f(m)) = f(m), ∀m ∈ N. Vậy ta có quan hệ hàm như sau 8 : f(m + f(n)) = f(m) + f(n) (1) f(0) = 0 (2) . GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

50. 6 KHAI THÁC TÍNH CHẤT ĐIỂM BẤT ĐỘNG CỦA HÀM SỐ b) Nhận thấy hàm f(0) ≡ 0 thỏa mãn yêu cầu bài toán. c) Tìm điểm cố định của hàm số. Nếu f không đồng nhất 0. Thì từ quan hệ f (f(m)) = f(m), ∀m ∈ N suy ra với mọi m ∈ N thì f(m) là điểm cố định của hàm số với m ∈ N. d) Tính chất của các điểm bất động. Nếu a và b là hai điểm bất động của hàm số f thì f(a + b) = f (a + f(b)) = f (f(a)) + f(b) = f(a) + f(b) = a + b. Vậy tập các điểm bất động bất biến qua phép cộng. e) Tập hợp các điểm bất động của f. Gọi a là điểm bất động khác 0 bé nhất của hàm số f. – Nếu a = 1, tức là f(1) = 1, thì dễ thấy rằng f(2) = 2 (bằng cách cho m = n = 1). Và áp dụng phương pháp quy nạp ta suy ra f(n) = n∀n ∈ N. – Nếu a 1, tức là f(a) = a. Bằng phương pháp quy nạp ta cũng chứng tỏ được là f(ka) = ka, ∀k ≥ 1. Ta chứng minh tập các điểm bất động động đều có dạng ka, ∀k ≥ 1(lưu ý là a là điểm bất động nhỏ nhất của hàm số). Thật vậy nếu n là điểm bất động khác thì n = ka + r(0 ≤ r a), khi đó theo (1) và tính chất điểm bất động của ka, ta có n = f(n) = f(ka + r) = f (r + f(ka)) = f(r) + f(ka) = f(r) + ka ⇒ f(r) = n − ka = r. Vì r a mà r lại là điểm bất động, a là điểm bất động nhỏ nhất, nên r = 0. Chứng tỏ các điểm bất động đều có dạng ka, ∀k ≥ 1 (*). f) Xây dựng hàm f. Vì {f(n) : n ∈ N} là tập các điểm bất động của hàm f. Vậy thì với i a thì do (*) nên ta có f(i) = nia với n0 = 0, ni ∈ N. Lấy số nguyên dương n bất kỳ thì ta có thể viết n = ka + i(0 ≤ i a). Theo quan hệ đầu bài thì f(n) = f(i + ka) = f (i + f(ka)) = f(i) + ka = nia + ka = (ni + k)a. Ta kiểm chứng hàm f như vậy thỏa mãn yêu cầu bài toán. Thật vậy, với m = ka + i, n = la + j , 0 ≤ i, j a thì f (m + f(n)) = f (la + j + f (ka + i)) = ka + i + f (f(la + i)) . GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

51. 6 KHAI THÁC TÍNH CHẤT ĐIỂM BẤT ĐỘNG CỦA HÀM SỐ Ví dụ 6.4. (AMM, E984) Tìm tất cả các hàm số f : R → R sao cho f(f(x)) = x2 − 2, ∀x ∈ R. Giải Ta chứng minh một kết quả tổng quát hơn: Cho S là một tập hợp và g : S → S là một hàm số có chính xác 2 điểm cố định {a, b} và g ◦ g có chính xác 4 điểm cố định {a, b, c, d}. Thì không tồn tại hàm số f : S → S để g = f ◦ f. Chứng minh Giả sử g(c) = y. Thì c = g (g(c)) = g(y), nên y = g(c) = g (g(y)). Do vậy y là một điểm cố định của g ◦ g. Nếu y = a thì a = g(a) = g(y) = c, dẫn đến mâu thuẫn. Tương tự cho y = b sẽ dẫn đến mâu thuẫn là c = b. Nếu y = c thì c = g(y) = g(c), tức c là điểm cố định của g, mâu thuẫn. Từ đó suy ra y = d, tức là g(c) = d, và tương tự thì g(d) = c. Giả sử tồn tại f : S → S sao cho f ◦ f = g. Thì f ◦ g = f ◦ f ◦ f = g ◦ f. Khi đó f(a) = f (g(a)) = g (f(a)), nên f(a) là một điểm cố định của g. Bằng việc kiểm tra từng trường hợp ta kết luận f{a, b} = {a, b}, f{a, b, c, d} = {a, b, c, d}. Xét f(c). Nếu f(c) = a, thì f(a) = f (f(c)) = g(c) = d, mâu thuẫn do f(a) nằm trong {a, b}. Tương tự cũng không thể xảy ra f(c) = b. Ngoài ra cũng không thể có f(c) = c vì c không là điểm cố định của g. Do vậy chỉ có khả năng là f(c) = d. Nhưng khi đó thì f(d) = f (f(c)) = g(c) = d, mâu thuẫn, vì điều này không thể xảy ra do d không phải là điểm cố định của g. Do vậy không thể tồn tại hàm f thỏa yêu cầu bài toán. Quay trở lại bài toán, bài toán là trường hợp đặc biệt của hàm g(x) = x2 − 2, có hai điểm cố định là −1 và 2, và g (g(x)) = (x2 − 2) 2 − 2 có các điểm cố định là −1, 2, −1 + √ 5 2 và −1 √ 5 2 . Áp dụng kết quả trên ta hoàn thành lời giải cho bài toán. GV: Trần Minh Hiền. . . . . .PTH bồi dưỡng học sinh giỏi . . . . . .Trường THPT chuyên Quang Trung www.VNMATH.com

Giáo Án Mĩ Thuật 6 / 2023

Ngày giảng: 20/10/09 Tiết 8 Bài 8: Thường thức mĩ thuật SƠ LƯỢC VỀ MĨ THUẬT THỜI LÝ (1010 – 1225) I. Mục tiêu: * Kiến thức: – Hs hiểu và nắm bắt được một số kiến thức chung về MT thời Lý. – Hs biết cảm nhận các giá trị nghệ thuật của MT thời Lý. * Kĩ năng: – Quan sát nhận xét, phân tích nội dung, nhận thức về bố cục. * Thái độ: – Hs nhận thức đúng đắn về truyền thống nghệ thuật dân tộc, trân trọng, yêu quý những di sản của cha ông để lại và tự hào về bản sắc độc đáo của nghệ thuật dân tộc. II. Chuẩn bị: 1. Đồ dùng dạy học: 1.1. Đối với giáo viên: – Hình ảnh một số tác phẩm ,công trình MT thời Lý . – Sưu tầm thêm một số tranh ảnh thuộc MT thời Lý đã in trong sách, báo… 1.2. Đối với học sinh: 2. Phương pháp – Trực quan, vấn đáp, thuyết trình III. Tiến trình dạy – học: Néi dung Ho¹t ®éng cña gv Tg Ho¹t ®éng cña hs Bài 8: SƠ LƯỢC VỀ MĨ THUẬT THỜI LÝ (1010 – 1225) I. Bèi c¶nh x¨ héi thêi Lý – Vua Lý Thái Tổ, với hoài bão xây dựng đất nước độc lập tự chủ đã dời đô từ Hoa Lư (Ninh Bình ) ra Đại La và đổi tên là Thăng Long (Hà Nội ngày nay), sau đó, Lý Thánh Tông đặt tên nước là Đại Việt – Đạo Phật đi vào cuộc sống đã khơi nguồn cho nghệ thuật phát triển ,nhiều công trình kiến trúc ,điêu khắc và hội họa đặc sắc đã ra đời trong thời kì này. II. S¬ l­îc vÒ MÜ thuËt thêi Lý * Gåm 3 loai h×nh nghÖ thuËt: – Kiến trúc – Điêu khắc và trang trí. – Gốm. 1. Nghệ thuật kiến trúc a, Kiến trúc cung đình -Thành tựu lớn nhất của kiến trúc cung là kinh thành Thăng Long -KTTL là một quần thể kiến trúc gồm 2 lớp:bên trong và bên ngoài: Bên trong được gọi là Hoàng thành, bên ngoài được gọi là Kinh thành -Hoàng thành là nơi ở ,nơi làm việc của vua và hoàng tộc. -Phía trong Hoành thành có xây dựng nhiều cung điện như điện Càn Nguyên, điện Tập Hiền ,điện Giảng Võ .Ngoài ra còn có điện Trường Xuân, điện Thiên An, điện Thiên Khánh… b/ Kiến trúc Phật giáo: – Thời Lý, nhiều công trình kiến trúc Phật giáo được xây dựng là do đạo Phật rất thịnh hành.Kiến trúc phật giáo có Tháp và Chùa. 2.Nghệ thuật điêu khắc và trang trí: a. Tượng -Néi dung t¹c t­îng thêi Lý là các pho tượng Phật Thế Tôn , Kim Cương,người chim, các con thú… b,Chạm khắc trang trí: -Đề tài của các tác phẩm điêu khắc là các loại hình hoa, lá, mây, sóng nước…hoa văn hình móc câu - -Một biểu tượng mang đặc trưng riêng của mỗi một thời kì đó là hình tượng con rồng 3/NghÖ thuËt gèm: – Cã nh÷ng TTSX nh­: Thăng Long,Bát Tràng ,Thổ Hà,Thanh Hóa….. – Chế tác được gốm men ngọc, men da lươn, men lục, men trắng ngà. + Xương gốm mỏng, nhẹ, nét khắc chìm, men phủ đều. Hình dáng thanh thoát, chau chuốt và mang vẻ đẹp trang trọng. – Ổn định lớp: Kiểm tra sĩ số. – KiÓm tra bµi cò: + Em hãy nêu cách vẽ theo mẫu? – Nhận xét cho điểm Hoạt động 1: Giới thiệu bài. – Ở tiết 2 các em đã được làm quen với phân môn ttmt đầu tiên của MT6, các em biết được một số thành tựu của Mt cổ đại và bài hôm nay bµi häc sẽ tạo điều kiện cho các em tiếp xúc, thưởng thức vẻ đẹp của một số thành tựu nghệ thuật thời Lý do ông cha để lại.Vậy những thành tựu đó là gì? Ta bắt đầu tìm hiểu bài 8: Sơ lược về mĩ thuật thời Lý. Hoạt động 2: Tìm hiểu khái quát về hoàn cảnh xã hội thời Lý. * Thông qua các bài học lịch sử ,em biết gì về triều đại Lý ? * Gv nhấn mạnh: – Sự cường thịnh của triều đại Lý được chứng minh qua cuộc chiến thắng giặc Tống xâm lược và đánh chiếm Chiêm Thành. -Bên cạnh đó nhà nước Đại Việt còn có nhiều chủ trương chính sách tiến bộ,hợp lòng dân nên kinh tế xã hội phát triển mạnh và ổn định, từ đó kéo theo văn hóa ,ngoại thương cùng phát triển. * Đạo Phật có tác động gì tới nghệ thuật thời Lý? * Những công trình kiến trúc, điêu khắc và hội họa đó đặc sắc như thế nào, ta vào phần 2 Sơ lược về mĩ thuật thời Lý. Hoạt động 3: Sơ lược về mĩ thuật thời Lý. * Ngoài ra còn có hội họa nhưng các tác phẩm đã bị thất lạc do thời gian, do chiến tranh và chỉ được ghi chép trong thư tịch. A.Tìm hiểu về nghệ thuật kiến trúc: Khi nói về MT thời Lý, ta đề cập nhiều đến nghệ thuật kiến trúc, loại hình nghệ thuật phát triển rất mạnh. Nghệ thuật kiến trúc có các loại hình kiến trúc nào? * Kiến trúc cung đình: – Thành tựu lớn nhất của kiến trúc cung đình là công trình nào? – Kinh thành Thăng Long do vua nào xây dựng? – KTTL được xây dựng như thế nào? – Lớp bên trong được gọi là gì? bên ngoài được gọi là gì? * Em hãy miêu tả Hoàng thành? – Vậy còn Kinh thành như thế nào? – Em có nhận xét gì về quy mô của kinh thành Thăng Long? * Kiến trúc Phật giáo: – Thời Lý, nhiều công trình kiến trúc Phật giáo được xây dựng là do đạo Phật rất thịnh hành.Kiến trúc phật giáo có Tháp và Chùa. – Em biết gì về tháp? -Chùa được xây dựng như thế nào?Em hãy kể tên một số chùa mà em biết.? – Giới thiệu hình ảnh chùa một cột B.Tìm hiểu về nghệ thuật điêu khắc và trang trí: – Em hãy cho biết nghệ thuật điêu khắc và trang trí có tác dụng gì đối với các công trình kiến trúc? *Tượng : Gv giới thiệu ,thuyết minh qua ảnh. -Các tác phẩm điêu khắc được làm bằng chất liệu gì? -Các tác phẩm tạc tượng gì? * Các bức tượng của MT thời Lý có hai đặc điểm mà chúng ta cần phải lưu ý : + Nhiều pho tượng có kích thước lớn như tượng Phật A-di-đà, tượng thú, tượng người chim ở chùa Phật Tích. + Các pho tượng đã thể hiện sự tiếp thu nghệ thuật của các nước láng giềng,sự gìn giữ bản sắc dân tộc độc đáo và đã chứng minh tài năng tạc tượng đá tuyệt vời của các nghệ nhân thời Lý. * Chạm khắc trang trí: +Các tác phẩm chạm khắc trang trí là những bức phù điêu đá, gỗ để trang trí cho các công trình kiến trúc. -Đề tài của các tác phẩm điêu khắc là gì? Gv nhÊn m¹nh: – Hoa văn hình móc câu : các nghệ nhân sử dụng loại hoa văn này như một loại hoa văn vạn năng,chỉ một thứ hoa văn ấy đã tạo nên nhiều bộ phận cho một con sư tử ,con rồng hoặc những họa tiết về mây ,hoa lá trên con vật ,trên quần áo giáp trụ của tượng Kim Cương… -Một biểu tượng mang đặc trưng riêng của mỗi một thời kì đó là hình tượng con rồng.Gv đưa ra hình ảnh con rồng thời Lý. -Em thấy con rồng thời Lý có đặc điểm gì? *.Tìm hiểu về nghệ thuật gốm: Gv đưa ra ảnh gốm: *Gốm là sản phẩm chủ yếu phục vụ đời sống con người, gồm có :bát , đĩa ,ấm chén ,bình rượu,bình hoa… -Thời Lý đã có những trung tâm sản xuất gốm nào? -Gốm thời Lý có những ®Æc ®iÓm g×? Hoạt động 4 :Đánh giá kết quả học tập : *Các công trình kiến trúc thời Lý như thế nào? – Có quy mô to lớn đặt tại các nơi, có địa hình thuận lợi, đẹp và thoáng đãng, phong cảnh sơn thủy hữu tình. -Ví sao kiến trúc phật giáo thời Lý phát triển? – Em hãy nêu đặc điểm hình tượng con rồng thời Lý ?. – Đồ gốm thời Lý có đặc điểm gì ? *Giáo viên nhận xét – Dặn dò : – Chuẩn bị cho bài sau. 3’ 2’ 5’ 30’ 5’ -Líp tr­ëng b¸o c¸o -HS chó ý nghe c©u hái vµ tr¶ lêi c©u hái -Hs ghi ®Çu bµi – Vua Lý Thái Tổ ,với hoài bão xây dựng đất nước độc lập tự chủ đã dời đô từ Hoa Lư (Ninh Bình ) ra Đại La và đổi tên là Thăng Long (Hà Nội ngày nay),sau đó ,Lý Thánh Tông đặt tên nước là Đại Việt – Đạo Phật đi vào cuộc sống đã khơi nguồn cho nghệ thuật phát triển – Kiến trúc – Điêu khắc và trang trí. – Gốm. – Kiến trúc cung đình và kiến trúc phật giáo. – Đó là kinh thành Thăng Long. – Vua Lý Thái Tổ. – KTTL là một quần thể kiến trúc gồm 2 lớp:bên trong và bên ngoài. – Bên trong được gọi là Hoàng thành, bên ngoài được gọi là Kinh thành. – Hoàng thành là nơi ở, nơi làm việc của vua và hoàng tộc. -Phía trong Hoành thành có xây dựng nhiều cung điện như điện Càn Nguyên, điện Tập Hiền, điện Giảng Võ .Ngoài ra còn có điện Trường Xuân, điện Thiên An, điện Thiên Khánh… – Kinh thành là nơi ở và sinh hoạt của các tầng lớp xã hội,với nhiều công trình kiến trúc nổi tiếng. – Đáng chú ý là các công trình: + Phía Bắc có hồ Dâm Đàm (Hồ Tây), đền Quán Thánh, cung Từ Hoa để công chúa và các cung nữ trồng dâu ,nuôi tằm và các làng hoa Nghi Tàm, Quảng Bá… + Phía Nam có Văn Miếu – Quốc Tử Giám và các trại lính. + Phía Đông là nơi buôn bán nhộn nhịp ,có hồ Lục Thủy ,tháp Báo Thiên, sông Hồng (thường là nơi mở hội đua thuyền ). + Phía Tây là khu nông nghiệp với nhiều trang trại trồng trọt – Kinh thành Thăng Long có quy mô to lớn và tráng lệ. – Tháp Phật là đề thờ phật giáo gắn với chùa,các tháp tiêu biểu là tháp Phật Tích (Bắc Ninh) ,tháp Chương Sơn (Nam Định) ,tháp Báo Thiên (Hà Nội) – Chùa có quy mô khá lớn,thường được đặt ở những nơi có cảnh trí đẹp,tọa thành một tổng thể kiến trúc cấn đối ,hòa nhập với môi trường tự nhiên xung quanh như: chùa Một Cột (Hà Nội),chùa Phật Tích (Bắc Ninh),chùa Dạm (Bắc Ninh),chùa Hương Lãng (Hưng Yên),chùa Long Đọi (Hà Nam)… – Nghệ thuật chạm khắc và trang trí có tác dụng trang trí, tôn thêm vẻ đẹp của các công trình kiến trúc. – Chất liệu là đá. – Đó là các pho tượng Phật Thế Tôn ,Kim Cương,người chim, các con thú… Đó là các loại hình hoa, lá, mây, sóng nước…hoa văn hình móc câu - -Hình rồng thời Lý không giống với hình vẽ rồng của ccs thời đại TQ .Rồng là hình tượng trang trí phổ biến trong hình lá đề, cánh hoa sen, ở bệ tượng, trong cánh cửa đền chùa… rồng thời Lý thể hiện trong dáng đấp hiền hòa, mềm mại, không có cặp sừng trên đầu : Luôn có hình chữ “S” một biểu tương cầu mưa của cư dân nông nghiệp trồng lúa nước. Rồng thời Lý mình tròn, thân lẳn khúc uốn lượn nhịp nhàng theo kiểu thắt túi tù to đến nhỏ dần về phía sau -Cã nh÷ng TTSX nh­: Thăng Long,Bát Tràng ,Thổ Hà,Thanh Hóa….. – Chế tác được gốm men ngọc, men da lươn, men lục, men trắng ngà. + Xương gốm mỏng, nhẹ, nét khắc chìm, men phủ đều. Hình dáng thanh thoát, chau chuốt và mang vẻ đẹp trang trọng. – Đạo phật được đề cao, sớm giữ địa vị quốc giáo, vì các vua quan nhà Lý rất sùng đạo phật -Tr¶ lêi -Tr¶ lêi